|
Name |
Integracin B
|
| Molecular Formula | C35H54O7 | |
| IUPAC Name* |
[(4R)-11-(3,5-dihydroxyphenyl)undecan-4-yl] 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]benzoate
|
|
| SMILES |
CCC[C@H](CCCCCCCC1=C(C(=CC(=C1)O)O)C(=O)O[C@H](CCC)CCCCCCCC2=CC(=CC(=C2)O)O)O
|
|
| InChI |
InChI=1S/C35H54O7/c1-3-15-28(36)19-13-9-6-8-12-18-27-23-31(39)25-33(40)34(27)35(41)42-32(16-4-2)20-14-10-5-7-11-17-26-21-29(37)24-30(38)22-26/h21-25,28,32,36-40H,3-20H2,1-2H3/t28-,32-/m1/s1
|
|
| InChIKey |
IKNYNBVDLOWJFN-AKGWNBJDSA-N
|
|
| Synonyms |
Integracin B; 224186-05-4; (4R)-11-(3,5-dihydroxyphenyl)undecan-4-yl 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]benzoate; 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]-benzoic acid, (1R)-8-(3,5-dihydroxyphenyl)-1-propyloctyl ester; CHEBI:66077; DTXSID101122052; HY-N7330; CS-0113365; Q27134589; (1R)-8-(3,5-Dihydroxyphenyl)-1-propyloctyl 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]benzoate; [(4R)-11-(3,5-dihydroxyphenyl)undecan-4-yl] 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]benzoate
|
|
| CAS | 224186-05-4 | |
| PubChem CID | 70678748 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 586.8 | ALogp: | 10.8 |
| HBD: | 5 | HBA: | 7 |
| Rotatable Bonds: | 23 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 127.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 42 | QED Weighted: | 0.064 |
| Caco-2 Permeability: | -5.654 | MDCK Permeability: | 0.00002370 |
| Pgp-inhibitor: | 0.055 | Pgp-substrate: | 0.751 |
| Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 100.13% |
| Volume Distribution (VD): | 1.425 | Fu: | 0.51% |
| CYP1A2-inhibitor: | 0.585 | CYP1A2-substrate: | 0.173 |
| CYP2C19-inhibitor: | 0.824 | CYP2C19-substrate: | 0.051 |
| CYP2C9-inhibitor: | 0.152 | CYP2C9-substrate: | 0.995 |
| CYP2D6-inhibitor: | 0.97 | CYP2D6-substrate: | 0.185 |
| CYP3A4-inhibitor: | 0.385 | CYP3A4-substrate: | 0.025 |
| Clearance (CL): | 8.392 | Half-life (T1/2): | 0.699 |
| hERG Blockers: | 0.386 | Human Hepatotoxicity (H-HT): | 0.315 |
| Drug-inuced Liver Injury (DILI): | 0.034 | AMES Toxicity: | 0.03 |
| Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.986 |
| Skin Sensitization: | 0.971 | Carcinogencity: | 0.02 |
| Eye Corrosion: | 0.019 | Eye Irritation: | 0.926 |
| Respiratory Toxicity: | 0.492 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003334 | ![]() |
0.848 | D0P1RL | ![]() |
0.331 | ||
| ENC003312 | ![]() |
0.544 | D0T9TJ | ![]() |
0.309 | ||
| ENC001482 | ![]() |
0.444 | D07ILQ | ![]() |
0.281 | ||
| ENC004818 | ![]() |
0.432 | D0O1PH | ![]() |
0.278 | ||
| ENC003741 | ![]() |
0.425 | D0L5YV | ![]() |
0.265 | ||
| ENC004669 | ![]() |
0.425 | D00MLW | ![]() |
0.263 | ||
| ENC004668 | ![]() |
0.417 | D00AOJ | ![]() |
0.259 | ||
| ENC001340 | ![]() |
0.412 | D00STJ | ![]() |
0.254 | ||
| ENC004673 | ![]() |
0.409 | D00FGR | ![]() |
0.253 | ||
| ENC004667 | ![]() |
0.402 | D0MM8N | ![]() |
0.252 | ||