![]() |
Name |
botryosphaerin H
|
Molecular Formula | C16H20O6 | |
IUPAC Name* |
(1S,7R,8R,9S,12S,16R)-7,8-dihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadec-2-ene-4,11-dione
|
|
SMILES |
C[C@]12CCC[C@]3([C@@H]1[C@@H]([C@H]([C@]4(C2=CC(=O)OC4)O)O)OC3=O)C
|
|
InChI |
InChI=1S/C16H20O6/c1-14-4-3-5-15(2)11(14)10(22-13(15)19)12(18)16(20)7-21-9(17)6-8(14)16/h6,10-12,18,20H,3-5,7H2,1-2H3/t10-,11+,12+,14+,15-,16-/m0/s1
|
|
InChIKey |
YSEQPMYIGMORKQ-DIEKJCKJSA-N
|
|
Synonyms |
botryosphaerin H; Botryospaerin H; CHEBI:141329; (3aS,5aS,6R,6aR,10bS,10cR)-6,6a-dihydroxy-3a,10b-dimethyl-1,2,3,3a,5a,6,6a,7,10b,10c-decahydro-4H,9H-[2]benzofuro[7,1-fg]isochromene-4,9-dione; (3aS,5aS,6R,6aR,10bS,10cR)-6,6a-dihydroxy-3a,10b-dimethyl-1,2,3,3a,5a,6,6a,7,10b,10c-decahydro-4H,9H-furo[2',3',4':4,5]naphtho[2,1-c]pyran-4,9-dione
|
|
CAS | NA | |
PubChem CID | 122384364 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.33 | ALogp: | 0.2 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 22 | QED Weighted: | 0.64 |
Caco-2 Permeability: | -5.439 | MDCK Permeability: | 0.00002230 |
Pgp-inhibitor: | 0.05 | Pgp-substrate: | 0.299 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.974 |
30% Bioavailability (F30%): | 0.781 |
Blood-Brain-Barrier Penetration (BBB): | 0.876 | Plasma Protein Binding (PPB): | 29.49% |
Volume Distribution (VD): | 0.411 | Fu: | 58.07% |
CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.966 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.759 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.061 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.052 |
CYP3A4-inhibitor: | 0.324 | CYP3A4-substrate: | 0.361 |
Clearance (CL): | 2.382 | Half-life (T1/2): | 0.701 |
hERG Blockers: | 0.058 | Human Hepatotoxicity (H-HT): | 0.265 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.227 |
Rat Oral Acute Toxicity: | 0.521 | Maximum Recommended Daily Dose: | 0.44 |
Skin Sensitization: | 0.091 | Carcinogencity: | 0.432 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.8 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003795 | ![]() |
0.616 | D0G6AB | ![]() |
0.312 | ||
ENC005203 | ![]() |
0.506 | D0IX6I | ![]() |
0.284 | ||
ENC002394 | ![]() |
0.506 | D0KR5B | ![]() |
0.272 | ||
ENC001928 | ![]() |
0.506 | D04GJN | ![]() |
0.267 | ||
ENC003679 | ![]() |
0.451 | D0G8BV | ![]() |
0.265 | ||
ENC002056 | ![]() |
0.424 | D0L2LS | ![]() |
0.263 | ||
ENC002903 | ![]() |
0.405 | D0Z1XD | ![]() |
0.260 | ||
ENC002832 | ![]() |
0.351 | D0IL7L | ![]() |
0.260 | ||
ENC005256 | ![]() |
0.349 | D0I2SD | ![]() |
0.255 | ||
ENC000924 | ![]() |
0.344 | D0R7JT | ![]() |
0.255 |