|
Name |
Wentilactone A
|
| Molecular Formula | C16H16O6 | |
| IUPAC Name* |
(1S,2S,4R,5R,6R,9R,17R)-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-10,15-diene-7,14-dione
|
|
| SMILES |
C[C@@]12[C@@H]3[C@@H](C=C4COC(=O)C=C4[C@]3([C@H]5[C@@H]([C@@H]1O)O5)C)OC2=O
|
|
| InChI |
InChI=1S/C16H16O6/c1-15-7-4-9(17)20-5-6(7)3-8-11(15)16(2,14(19)21-8)12(18)10-13(15)22-10/h3-4,8,10-13,18H,5H2,1-2H3/t8-,10-,11-,12+,13-,15-,16-/m1/s1
|
|
| InChIKey |
UBQJSYFOVWBSFP-XUBUYMCTSA-N
|
|
| Synonyms |
Wentilactone A; 76235-83-1; 581J1Y5MJ6; UNII-581J1Y5MJ6; CHEMBL2011694; DTXSID70997579; 3H,8H-Furo(2',3',4':4,5)oxireno(7,8)naphtho(2,1-c)pyran-3,8-dione,1a,2,2a,4a,4b,6,9b,9c-octahydro-2-hydroxy-2a,9b-dimethyl-, (1aR,2R,2aR,4aR,4bR,9bS,9cS)-; Q27261539; 2-Hydroxy-2a,9b-dimethyl-1a,2,2a,4a,4b,6,9b,9c-octahydro-3H,8H-furo[2',3',4':4,5]oxireno[7,8]naphtho[2,1-c]pyran-3,8-dione; 3H,8H-FURO(2',3',4':4,5)OXIRENO(7,8)NAPHTHO(2,1-C)PYRAN-3,8-DIONE, 1A,2,2A,4A,4B,6,9B,9C-OCTAHYDRO-2-HYDROXY-2A,9B-DIMETHYL-, (1AR,2R,2AR,4AR,4BR,9BS,9CS)-
|
|
| CAS | 76235-83-1 | |
| PubChem CID | 156679 | |
| ChEMBL ID | CHEMBL2011694 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 304.29 | ALogp: | -0.5 |
| HBD: | 1 | HBA: | 6 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 85.4 | Aromatic Rings: | 5 |
| Heavy Atoms: | 22 | QED Weighted: | 0.518 |
| Caco-2 Permeability: | -5.326 | MDCK Permeability: | 0.00001990 |
| Pgp-inhibitor: | 0.853 | Pgp-substrate: | 0.838 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.996 |
| 30% Bioavailability (F30%): | 0.921 |
| Blood-Brain-Barrier Penetration (BBB): | 0.85 | Plasma Protein Binding (PPB): | 56.75% |
| Volume Distribution (VD): | 0.589 | Fu: | 61.92% |
| CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.126 |
| CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.559 |
| CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.034 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.077 |
| CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.406 |
| Clearance (CL): | 6.549 | Half-life (T1/2): | 0.873 |
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.165 |
| Drug-inuced Liver Injury (DILI): | 0.815 | AMES Toxicity: | 0.536 |
| Rat Oral Acute Toxicity: | 0.949 | Maximum Recommended Daily Dose: | 0.784 |
| Skin Sensitization: | 0.945 | Carcinogencity: | 0.188 |
| Eye Corrosion: | 0.906 | Eye Irritation: | 0.59 |
| Respiratory Toxicity: | 0.954 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002851 | ![]() |
0.644 | D0G6AB | ![]() |
0.255 | ||
| ENC002850 | ![]() |
0.608 | D06AEO | ![]() |
0.234 | ||
| ENC002903 | ![]() |
0.566 | D0K7LU | ![]() |
0.222 | ||
| ENC002394 | ![]() |
0.519 | D0D2VS | ![]() |
0.220 | ||
| ENC001928 | ![]() |
0.519 | D0A2AJ | ![]() |
0.207 | ||
| ENC005203 | ![]() |
0.519 | D0C7JF | ![]() |
0.206 | ||
| ENC003795 | ![]() |
0.352 | D04GJN | ![]() |
0.206 | ||
| ENC003323 | ![]() |
0.344 | D04QNO | ![]() |
0.205 | ||
| ENC003927 | ![]() |
0.309 | D0Y7IU | ![]() |
0.205 | ||
| ENC005049 | ![]() |
0.299 | D02JNM | ![]() |
0.202 | ||