![]() |
Name |
Smardaesidin E, (rel)-
|
Molecular Formula | C20H28O5 | |
IUPAC Name* |
(1R,2R,4S,5R,8S,9S,10S)-5-ethenyl-2,4,8-trihydroxy-5,11,11-trimethyl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadec-6-en-15-one
|
|
SMILES |
C[C@]1(C=C2[C@@H]([C@@H]3[C@@H]4[C@@]([C@]2(C[C@@H]1O)O)(CCCC4(C)C)C(=O)O3)O)C=C
|
|
InChI |
InChI=1S/C20H28O5/c1-5-18(4)9-11-13(22)14-15-17(2,3)7-6-8-19(15,16(23)25-14)20(11,24)10-12(18)21/h5,9,12-15,21-22,24H,1,6-8,10H2,2-4H3/t12-,13-,14+,15-,18+,19-,20+/m0/s1
|
|
InChIKey |
GMBCLCQVLOXAGM-JFNPQPDZSA-N
|
|
Synonyms |
Smardaesidin E; Smardaesidin E, (rel)-; CHEBI:69491; Q27137829
|
|
CAS | NA | |
PubChem CID | 56599464 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 348.4 | ALogp: | 1.6 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 25 | QED Weighted: | 0.5 |
Caco-2 Permeability: | -4.79 | MDCK Permeability: | 0.00002870 |
Pgp-inhibitor: | 0.283 | Pgp-substrate: | 0.204 |
Human Intestinal Absorption (HIA): | 0.061 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.647 | Plasma Protein Binding (PPB): | 64.52% |
Volume Distribution (VD): | 1.075 | Fu: | 38.92% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.231 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.743 |
CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.105 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.087 |
CYP3A4-inhibitor: | 0.651 | CYP3A4-substrate: | 0.43 |
Clearance (CL): | 3.78 | Half-life (T1/2): | 0.172 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.2 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.984 | Maximum Recommended Daily Dose: | 0.924 |
Skin Sensitization: | 0.08 | Carcinogencity: | 0.922 |
Eye Corrosion: | 0.027 | Eye Irritation: | 0.086 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001409 | ![]() |
0.462 | D0L2LS | ![]() |
0.294 | ||
ENC002083 | ![]() |
0.461 | D0P0HT | ![]() |
0.275 | ||
ENC002731 | ![]() |
0.411 | D0H2MO | ![]() |
0.266 | ||
ENC002831 | ![]() |
0.398 | D04VIS | ![]() |
0.262 | ||
ENC002829 | ![]() |
0.384 | D08PIQ | ![]() |
0.261 | ||
ENC002830 | ![]() |
0.379 | D0R7JT | ![]() |
0.261 | ||
ENC002087 | ![]() |
0.376 | D0C8HR | ![]() |
0.259 | ||
ENC002041 | ![]() |
0.365 | D0CW1P | ![]() |
0.257 | ||
ENC002906 | ![]() |
0.361 | D0IT2G | ![]() |
0.257 | ||
ENC002007 | ![]() |
0.354 | D03BLF | ![]() |
0.257 |