|
Name |
7-chloro-3-[(7-formyl-6-hydroxy-1,4-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)methoxy]-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid
|
| Molecular Formula | C27H33ClO10 | |
| IUPAC Name* |
7-chloro-3-[(7-formyl-6-hydroxy-1,4-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)methoxy]-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid
|
|
| SMILES |
CC1(C(CCC2(C13C(O3)CC(C2C(=O)O)(C)OCC4=C(C(=C5C(OC(=O)C5=C4OC)OC)C=O)O)C)Cl)C
|
|
| InChI |
InChI=1S/C27H33ClO10/c1-24(2)14(28)7-8-25(3)20(21(31)32)26(4,9-15-27(24,25)38-15)36-11-13-18(30)12(10-29)16-17(19(13)34-5)22(33)37-23(16)35-6/h10,14-15,20,23,30H,7-9,11H2,1-6H3,(H,31,32)
|
|
| InChIKey |
QCCLTKDRMPDYRK-UHFFFAOYSA-N
|
|
| Synonyms |
Pestalotiopen A
|
|
| CAS | NA | |
| PubChem CID | 102501043 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 553.0 | ALogp: | 3.1 |
| HBD: | 2 | HBA: | 10 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 141.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 38 | QED Weighted: | 0.213 |
| Caco-2 Permeability: | -5.529 | MDCK Permeability: | 0.00000788 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.022 |
| Human Intestinal Absorption (HIA): | 0.253 | 20% Bioavailability (F20%): | 0.134 |
| 30% Bioavailability (F30%): | 0.056 |
| Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 92.71% |
| Volume Distribution (VD): | 1.192 | Fu: | 6.78% |
| CYP1A2-inhibitor: | 0.039 | CYP1A2-substrate: | 0.964 |
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.662 |
| CYP2C9-inhibitor: | 0.184 | CYP2C9-substrate: | 0.527 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.163 |
| CYP3A4-inhibitor: | 0.044 | CYP3A4-substrate: | 0.071 |
| Clearance (CL): | 7.016 | Half-life (T1/2): | 0.202 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.192 |
| Drug-inuced Liver Injury (DILI): | 0.954 | AMES Toxicity: | 0.294 |
| Rat Oral Acute Toxicity: | 0.93 | Maximum Recommended Daily Dose: | 0.046 |
| Skin Sensitization: | 0.355 | Carcinogencity: | 0.788 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.43 |
| Respiratory Toxicity: | 0.87 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003276 | ![]() |
0.681 | D06IIB | ![]() |
0.248 | ||
| ENC002424 | ![]() |
0.439 | D02JNM | ![]() |
0.243 | ||
| ENC004367 | ![]() |
0.313 | D0Y2YP | ![]() |
0.240 | ||
| ENC005911 | ![]() |
0.313 | D03ZZK | ![]() |
0.233 | ||
| ENC005912 | ![]() |
0.313 | D0Q4SD | ![]() |
0.232 | ||
| ENC004661 | ![]() |
0.308 | D0H2MO | ![]() |
0.231 | ||
| ENC002386 | ![]() |
0.298 | D02QJH | ![]() |
0.229 | ||
| ENC003163 | ![]() |
0.281 | D0Q0PR | ![]() |
0.221 | ||
| ENC005965 | ![]() |
0.281 | D04FBR | ![]() |
0.219 | ||
| ENC003138 | ![]() |
0.279 | D09WYX | ![]() |
0.218 | ||