|
Name |
Diepoxin delta
|
| Molecular Formula | C20H16O8 | |
| IUPAC Name* |
(1'S,2'S,3'R,5'R,7'R,10'R,11'S)-2',10',11'-trihydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodecane]-8'-one
|
|
| SMILES |
C1[C@H]([C@@H]([C@]23[C@H]([C@@H]4[C@@H](O4)C5([C@@]2(C1=O)O3)OC6=CC=CC7=C6C(=CC=C7)O5)O)O)O
|
|
| InChI |
InChI=1S/C20H16O8/c21-9-7-12(22)19-18(28-19,15(9)23)16(24)14-17(25-14)20(19)26-10-5-1-3-8-4-2-6-11(27-20)13(8)10/h1-6,9,14-17,21,23-24H,7H2/t9-,14-,15+,16+,17-,18+,19+/m1/s1
|
|
| InChIKey |
AEHDWPXNIOFWQB-XIZHOQIMSA-N
|
|
| Synonyms |
Diepoxin delta; CHEMBL3342627
|
|
| CAS | NA | |
| PubChem CID | 102223270 | |
| ChEMBL ID | CHEMBL3342627 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 384.3 | ALogp: | -0.5 |
| HBD: | 3 | HBA: | 8 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 121.0 | Aromatic Rings: | 7 |
| Heavy Atoms: | 28 | QED Weighted: | 0.546 |
| Caco-2 Permeability: | -5.79 | MDCK Permeability: | 0.00003330 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.994 |
| Human Intestinal Absorption (HIA): | 0.143 | 20% Bioavailability (F20%): | 0.091 |
| 30% Bioavailability (F30%): | 0.949 |
| Blood-Brain-Barrier Penetration (BBB): | 0.67 | Plasma Protein Binding (PPB): | 87.99% |
| Volume Distribution (VD): | 0.48 | Fu: | 3.88% |
| CYP1A2-inhibitor: | 0.077 | CYP1A2-substrate: | 0.481 |
| CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.554 |
| CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.045 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.175 |
| CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.429 |
| Clearance (CL): | 9.485 | Half-life (T1/2): | 0.655 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.994 |
| Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.949 |
| Rat Oral Acute Toxicity: | 0.742 | Maximum Recommended Daily Dose: | 0.057 |
| Skin Sensitization: | 0.891 | Carcinogencity: | 0.827 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.023 |
| Respiratory Toxicity: | 0.945 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002330 | ![]() |
1.000 | D0Q3VE | ![]() |
0.242 | ||
| ENC003238 | ![]() |
0.831 | D08CCE | ![]() |
0.228 | ||
| ENC001999 | ![]() |
0.717 | D06ALD | ![]() |
0.217 | ||
| ENC001988 | ![]() |
0.681 | D06TJJ | ![]() |
0.216 | ||
| ENC002185 | ![]() |
0.663 | D01TNW | ![]() |
0.215 | ||
| ENC003195 | ![]() |
0.656 | D00JRA | ![]() |
0.211 | ||
| ENC003194 | ![]() |
0.606 | D06BQU | ![]() |
0.205 | ||
| ENC003198 | ![]() |
0.580 | D0AZ8C | ![]() |
0.203 | ||
| ENC003197 | ![]() |
0.559 | D08DFX | ![]() |
0.201 | ||
| ENC003196 | ![]() |
0.544 | D05MQK | ![]() |
0.197 | ||