|
Name |
Palmarumycin B5
|
| Molecular Formula | C20H18O8 | |
| IUPAC Name* |
(3'S,4'R,6'S,7'R,8'aR)-3',4',6',7',8'a-pentahydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-one
|
|
| SMILES |
C1[C@@H]([C@@H](C2=C[C@@H]([C@H](C3([C@@]2(C1=O)O)OC4=CC=CC5=C4C(=CC=C5)O3)O)O)O)O
|
|
| InChI |
InChI=1S/C20H18O8/c21-11-8-15(23)19(26)10(17(11)24)7-12(22)18(25)20(19)27-13-5-1-3-9-4-2-6-14(28-20)16(9)13/h1-7,11-12,17-18,21-22,24-26H,8H2/t11-,12-,17+,18+,19+/m0/s1
|
|
| InChIKey |
QUYXDKPCDHWNLZ-OHUKFJGISA-N
|
|
| Synonyms |
Palmarumycin B5; CHEMBL3342636
|
|
| CAS | NA | |
| PubChem CID | 101888373 | |
| ChEMBL ID | CHEMBL3342636 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 386.4 | ALogp: | -1.2 |
| HBD: | 5 | HBA: | 8 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 137.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 28 | QED Weighted: | 0.394 |
| Caco-2 Permeability: | -5.663 | MDCK Permeability: | 0.00001170 |
| Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.748 | 20% Bioavailability (F20%): | 0.944 |
| 30% Bioavailability (F30%): | 0.96 |
| Blood-Brain-Barrier Penetration (BBB): | 0.286 | Plasma Protein Binding (PPB): | 80.47% |
| Volume Distribution (VD): | 0.986 | Fu: | 12.33% |
| CYP1A2-inhibitor: | 0.061 | CYP1A2-substrate: | 0.092 |
| CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.638 |
| CYP2C9-inhibitor: | 0.011 | CYP2C9-substrate: | 0.311 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.121 |
| CYP3A4-inhibitor: | 0.02 | CYP3A4-substrate: | 0.215 |
| Clearance (CL): | 2.212 | Half-life (T1/2): | 0.432 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.943 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.588 |
| Rat Oral Acute Toxicity: | 0.726 | Maximum Recommended Daily Dose: | 0.37 |
| Skin Sensitization: | 0.094 | Carcinogencity: | 0.722 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.811 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003239 | ![]() |
0.580 | D0Q3VE | ![]() |
0.246 | ||
| ENC002330 | ![]() |
0.580 | D08CCE | ![]() |
0.243 | ||
| ENC003195 | ![]() |
0.570 | D06TJJ | ![]() |
0.240 | ||
| ENC003194 | ![]() |
0.554 | D0AZ8C | ![]() |
0.239 | ||
| ENC003197 | ![]() |
0.524 | D00JRA | ![]() |
0.225 | ||
| ENC003196 | ![]() |
0.524 | D06ALD | ![]() |
0.221 | ||
| ENC003238 | ![]() |
0.505 | D01TNW | ![]() |
0.219 | ||
| ENC001999 | ![]() |
0.500 | D05MQK | ![]() |
0.218 | ||
| ENC003287 | ![]() |
0.500 | D09LDR | ![]() |
0.216 | ||
| ENC003288 | ![]() |
0.500 | D08DFX | ![]() |
0.213 | ||