|
Name |
Palmarumycin B3
|
| Molecular Formula | C20H18O8 | |
| IUPAC Name* |
(1S,2S,3S,4R,6S,7R,10S)-spiro[11-oxatricyclo[4.4.1.01,6]undec-8-ene-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-2,3,4,7,10-pentol
|
|
| SMILES |
C1=CC2=C3C(=C1)OC4([C@@H]([C@H]([C@@H]([C@@]56[C@@]4(O5)[C@@H](C=C[C@@H]6O)O)O)O)O)OC3=CC=C2
|
|
| InChI |
InChI=1S/C20H18O8/c21-12-7-8-13(22)19-18(12,28-19)16(24)15(23)17(25)20(19)26-10-5-1-3-9-4-2-6-11(27-20)14(9)10/h1-8,12-13,15-17,21-25H/t12-,13+,15-,16-,17+,18-,19-/m0/s1
|
|
| InChIKey |
PKEIHANGEAWICI-XJOGIRLRSA-N
|
|
| Synonyms |
Palmarumycin B3; CHEMBL3342634
|
|
| CAS | NA | |
| PubChem CID | 101888371 | |
| ChEMBL ID | CHEMBL3342634 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 386.4 | ALogp: | -0.9 |
| HBD: | 5 | HBA: | 8 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 132.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 28 | QED Weighted: | 0.307 |
| Caco-2 Permeability: | -5.753 | MDCK Permeability: | 0.00002870 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.21 |
| Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.029 |
| 30% Bioavailability (F30%): | 0.973 |
| Blood-Brain-Barrier Penetration (BBB): | 0.309 | Plasma Protein Binding (PPB): | 93.56% |
| Volume Distribution (VD): | 0.48 | Fu: | 3.59% |
| CYP1A2-inhibitor: | 0.055 | CYP1A2-substrate: | 0.107 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.302 |
| CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.337 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.222 |
| CYP3A4-inhibitor: | 0.017 | CYP3A4-substrate: | 0.074 |
| Clearance (CL): | 5.477 | Half-life (T1/2): | 0.524 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.988 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.587 |
| Rat Oral Acute Toxicity: | 0.592 | Maximum Recommended Daily Dose: | 0.026 |
| Skin Sensitization: | 0.139 | Carcinogencity: | 0.94 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.978 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002185 | ![]() |
0.784 | D0Q3VE | ![]() |
0.264 | ||
| ENC003197 | ![]() |
0.736 | D06BQU | ![]() |
0.229 | ||
| ENC003194 | ![]() |
0.717 | D01TNW | ![]() |
0.227 | ||
| ENC003195 | ![]() |
0.629 | D08DFX | ![]() |
0.221 | ||
| ENC001988 | ![]() |
0.570 | D08CCE | ![]() |
0.219 | ||
| ENC001999 | ![]() |
0.570 | D06ALD | ![]() |
0.219 | ||
| ENC003239 | ![]() |
0.544 | D0AZ8C | ![]() |
0.212 | ||
| ENC002330 | ![]() |
0.544 | D06TJJ | ![]() |
0.208 | ||
| ENC003198 | ![]() |
0.524 | D00JRA | ![]() |
0.202 | ||
| ENC003238 | ![]() |
0.500 | D0O6IZ | ![]() |
0.198 | ||