|
Name |
Arisugacin J
|
| Molecular Formula | C27H32O8 | |
| IUPAC Name* |
(1S,2S,5R,7R,10R)-1,5,7-trihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-diene-3,16-dione
|
|
| SMILES |
C[C@@]12CC[C@@]3([C@@]([C@]1(CC4=C(O2)C=C(OC4=O)C5=CC=C(C=C5)OC)O)(C(=O)C[C@H](C3(C)C)O)C)O
|
|
| InChI |
InChI=1S/C27H32O8/c1-23(2)20(28)13-21(29)25(4)26(23,31)11-10-24(3)27(25,32)14-17-19(35-24)12-18(34-22(17)30)15-6-8-16(33-5)9-7-15/h6-9,12,20,28,31-32H,10-11,13-14H2,1-5H3/t20-,24-,25+,26-,27-/m1/s1
|
|
| InChIKey |
OQZMMSBLGYHONG-ZJQFWPFFSA-N
|
|
| Synonyms |
CHEMBL4440372; Arisugacin J; Arisugacin O; BDBM50530476
|
|
| CAS | NA | |
| PubChem CID | 102132271 | |
| ChEMBL ID | CHEMBL4440372 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 484.5 | ALogp: | 1.7 |
| HBD: | 3 | HBA: | 8 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 123.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 35 | QED Weighted: | 0.592 |
| Caco-2 Permeability: | -5.12 | MDCK Permeability: | 0.00001410 |
| Pgp-inhibitor: | 0.316 | Pgp-substrate: | 0.994 |
| Human Intestinal Absorption (HIA): | 0.216 | 20% Bioavailability (F20%): | 0.831 |
| 30% Bioavailability (F30%): | 0.897 |
| Blood-Brain-Barrier Penetration (BBB): | 0.801 | Plasma Protein Binding (PPB): | 82.06% |
| Volume Distribution (VD): | 1.075 | Fu: | 12.22% |
| CYP1A2-inhibitor: | 0.735 | CYP1A2-substrate: | 0.934 |
| CYP2C19-inhibitor: | 0.809 | CYP2C19-substrate: | 0.645 |
| CYP2C9-inhibitor: | 0.808 | CYP2C9-substrate: | 0.257 |
| CYP2D6-inhibitor: | 0.082 | CYP2D6-substrate: | 0.428 |
| CYP3A4-inhibitor: | 0.809 | CYP3A4-substrate: | 0.794 |
| Clearance (CL): | 7.064 | Half-life (T1/2): | 0.104 |
| hERG Blockers: | 0.103 | Human Hepatotoxicity (H-HT): | 0.705 |
| Drug-inuced Liver Injury (DILI): | 0.868 | AMES Toxicity: | 0.028 |
| Rat Oral Acute Toxicity: | 0.978 | Maximum Recommended Daily Dose: | 0.941 |
| Skin Sensitization: | 0.113 | Carcinogencity: | 0.962 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.971 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003231 | ![]() |
0.725 | D06XZW | ![]() |
0.257 | ||
| ENC002037 | ![]() |
0.632 | D0N0RU | ![]() |
0.250 | ||
| ENC003130 | ![]() |
0.573 | D0P1UX | ![]() |
0.248 | ||
| ENC000932 | ![]() |
0.560 | D04UTT | ![]() |
0.245 | ||
| ENC002118 | ![]() |
0.399 | D09WKB | ![]() |
0.242 | ||
| ENC002102 | ![]() |
0.392 | D06HBQ | ![]() |
0.238 | ||
| ENC003423 | ![]() |
0.388 | D06GCK | ![]() |
0.233 | ||
| ENC003422 | ![]() |
0.388 | D07MGA | ![]() |
0.228 | ||
| ENC002412 | ![]() |
0.368 | D02DPU | ![]() |
0.228 | ||
| ENC005020 | ![]() |
0.365 | D0Q0PR | ![]() |
0.223 | ||