|
Name |
Decaturin F
|
| Molecular Formula | C29H35NO5 | |
| IUPAC Name* |
(2S,4aR,4bS,8S,8aR,10aS)-2,4a-dihydroxy-1,1,7,8a-tetramethyl-6'-pyridin-3-ylspiro[2,3,4,4b,5,9,10,10a-octahydrophenanthrene-8,2'-3H-furo[3,2-c]pyran]-4'-one
|
|
| SMILES |
CC1=CC[C@H]2[C@]([C@]13CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)(CC[C@@H]6[C@@]2(CC[C@@H](C6(C)C)O)O)C
|
|
| InChI |
InChI=1S/C29H35NO5/c1-17-7-8-23-27(4,11-9-22-26(2,3)24(31)10-12-28(22,23)33)29(17)15-19-21(35-29)14-20(34-25(19)32)18-6-5-13-30-16-18/h5-7,13-14,16,22-24,31,33H,8-12,15H2,1-4H3/t22-,23-,24-,27+,28+,29-/m0/s1
|
|
| InChIKey |
CHRFMXAKYLZBKQ-LNCRQVRISA-N
|
|
| Synonyms |
Decaturin F; J3.516.335B
|
|
| CAS | NA | |
| PubChem CID | 132562213 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 477.6 | ALogp: | 3.5 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 88.9 | Aromatic Rings: | 6 |
| Heavy Atoms: | 35 | QED Weighted: | 0.554 |
| Caco-2 Permeability: | -4.74 | MDCK Permeability: | 0.00002920 |
| Pgp-inhibitor: | 0.976 | Pgp-substrate: | 0.509 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.954 |
| 30% Bioavailability (F30%): | 0.941 |
| Blood-Brain-Barrier Penetration (BBB): | 0.866 | Plasma Protein Binding (PPB): | 85.81% |
| Volume Distribution (VD): | 1.657 | Fu: | 12.70% |
| CYP1A2-inhibitor: | 0.179 | CYP1A2-substrate: | 0.296 |
| CYP2C19-inhibitor: | 0.308 | CYP2C19-substrate: | 0.41 |
| CYP2C9-inhibitor: | 0.839 | CYP2C9-substrate: | 0.202 |
| CYP2D6-inhibitor: | 0.026 | CYP2D6-substrate: | 0.465 |
| CYP3A4-inhibitor: | 0.886 | CYP3A4-substrate: | 0.241 |
| Clearance (CL): | 9.397 | Half-life (T1/2): | 0.184 |
| hERG Blockers: | 0.356 | Human Hepatotoxicity (H-HT): | 0.526 |
| Drug-inuced Liver Injury (DILI): | 0.205 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.843 | Maximum Recommended Daily Dose: | 0.982 |
| Skin Sensitization: | 0.547 | Carcinogencity: | 0.32 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.956 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003422 | ![]() |
0.867 | D02STN | ![]() |
0.341 | ||
| ENC002412 | ![]() |
0.724 | D06CNP | ![]() |
0.321 | ||
| ENC002118 | ![]() |
0.719 | D0L2LS | ![]() |
0.264 | ||
| ENC002102 | ![]() |
0.656 | D04GJN | ![]() |
0.258 | ||
| ENC002080 | ![]() |
0.603 | D09IPV | ![]() |
0.243 | ||
| ENC003611 | ![]() |
0.534 | D0Q6NZ | ![]() |
0.242 | ||
| ENC005020 | ![]() |
0.520 | D0Z1XD | ![]() |
0.242 | ||
| ENC002192 | ![]() |
0.508 | D08QKJ | ![]() |
0.239 | ||
| ENC002410 | ![]() |
0.507 | D0V4WD | ![]() |
0.238 | ||
| ENC002411 | ![]() |
0.500 | D0U3GL | ![]() |
0.233 | ||