|
Name |
Decaturin A
|
| Molecular Formula | C30H35NO6 | |
| IUPAC Name* |
(1R,2S,6S,7R,10S,12S)-10,12-dihydroxy-5,7,11,11-tetramethyl-6'-pyridin-3-ylspiro[13-oxatetracyclo[10.2.2.01,10.02,7]hexadec-4-ene-6,2'-3H-furo[3,2-c]pyran]-4'-one
|
|
| SMILES |
CC1=CC[C@H]2[C@]([C@]13CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)(CC[C@@]6([C@]27CC[C@@](C6(C)C)(OC7)O)O)C
|
|
| InChI |
InChI=1S/C30H35NO6/c1-18-7-8-23-26(4,9-11-29(33)25(2,3)30(34)12-10-27(23,29)17-35-30)28(18)15-20-22(37-28)14-21(36-24(20)32)19-6-5-13-31-16-19/h5-7,13-14,16,23,33-34H,8-12,15,17H2,1-4H3/t23-,26+,27-,28-,29+,30-/m0/s1
|
|
| InChIKey |
SDTZNNOXVFJOFR-YOJVQXBKSA-N
|
|
| Synonyms |
Decaturin A; J1.890.256G; (1R,2S,6S,7R,10S,12S)-10,12-Dihydroxy-5,7,11,11-tetramethyl-6'-pyridin-3-ylspiro[13-oxatetracyclo[10.2.2.01,10.02,7]hexadec-4-ene-6,2'-3H-furo[3,2-c]pyran]-4'-one
|
|
| CAS | NA | |
| PubChem CID | 11049418 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 505.6 | ALogp: | 2.9 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 98.1 | Aromatic Rings: | 8 |
| Heavy Atoms: | 37 | QED Weighted: | 0.531 |
| Caco-2 Permeability: | -4.974 | MDCK Permeability: | 0.00001760 |
| Pgp-inhibitor: | 0.863 | Pgp-substrate: | 0.109 |
| Human Intestinal Absorption (HIA): | 0.051 | 20% Bioavailability (F20%): | 0.81 |
| 30% Bioavailability (F30%): | 0.566 |
| Blood-Brain-Barrier Penetration (BBB): | 0.967 | Plasma Protein Binding (PPB): | 84.46% |
| Volume Distribution (VD): | 2.182 | Fu: | 14.20% |
| CYP1A2-inhibitor: | 0.318 | CYP1A2-substrate: | 0.926 |
| CYP2C19-inhibitor: | 0.711 | CYP2C19-substrate: | 0.653 |
| CYP2C9-inhibitor: | 0.75 | CYP2C9-substrate: | 0.027 |
| CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.137 |
| CYP3A4-inhibitor: | 0.96 | CYP3A4-substrate: | 0.675 |
| Clearance (CL): | 9.577 | Half-life (T1/2): | 0.146 |
| hERG Blockers: | 0.545 | Human Hepatotoxicity (H-HT): | 0.733 |
| Drug-inuced Liver Injury (DILI): | 0.499 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.514 | Maximum Recommended Daily Dose: | 0.963 |
| Skin Sensitization: | 0.505 | Carcinogencity: | 0.938 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.974 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003611 | ![]() |
0.780 | D02STN | ![]() |
0.288 | ||
| ENC002412 | ![]() |
0.746 | D06CNP | ![]() |
0.281 | ||
| ENC003423 | ![]() |
0.656 | D04GJN | ![]() |
0.211 | ||
| ENC003422 | ![]() |
0.629 | D0N0RU | ![]() |
0.208 | ||
| ENC002118 | ![]() |
0.616 | D0L2LS | ![]() |
0.207 | ||
| ENC002080 | ![]() |
0.588 | D0V4WD | ![]() |
0.206 | ||
| ENC002411 | ![]() |
0.522 | D0Z1XD | ![]() |
0.204 | ||
| ENC002410 | ![]() |
0.455 | D09IPV | ![]() |
0.199 | ||
| ENC005020 | ![]() |
0.420 | D0Q6NZ | ![]() |
0.197 | ||
| ENC002192 | ![]() |
0.411 | D0U3GL | ![]() |
0.196 | ||