![]() |
Name |
1,2-Benzenedimethanethiol, TMS derivative
|
Molecular Formula | C11H18S2Si | |
IUPAC Name* |
[2-(trimethylsilylsulfanylmethyl)phenyl]methanethiol
|
|
SMILES |
C[Si](C)(C)SCC1=CC=CC=C1CS
|
|
InChI |
InChI=1S/C11H18S2Si/c1-14(2,3)13-9-11-7-5-4-6-10(11)8-12/h4-7,12H,8-9H2,1-3H3
|
|
InChIKey |
UOCQOJYGXKUJPM-UHFFFAOYSA-N
|
|
Synonyms |
1,2-Benzenedimethanethiol, TMS derivative; 1,2-Benzenedimethanethiol, S-trimethylsilyl-
|
|
CAS | NA | |
PubChem CID | 91696602 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 242.5 | ALogp: | 4.2 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.586 |
Caco-2 Permeability: | -4.958 | MDCK Permeability: | 0.00000583 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.068 |
Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 100.51% |
Volume Distribution (VD): | 2.752 | Fu: | 1.82% |
CYP1A2-inhibitor: | 0.971 | CYP1A2-substrate: | 0.95 |
CYP2C19-inhibitor: | 0.899 | CYP2C19-substrate: | 0.78 |
CYP2C9-inhibitor: | 0.643 | CYP2C9-substrate: | 0.771 |
CYP2D6-inhibitor: | 0.198 | CYP2D6-substrate: | 0.861 |
CYP3A4-inhibitor: | 0.169 | CYP3A4-substrate: | 0.426 |
Clearance (CL): | 9.027 | Half-life (T1/2): | 0.562 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.297 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.224 |
Skin Sensitization: | 0.933 | Carcinogencity: | 0.301 |
Eye Corrosion: | 0.992 | Eye Irritation: | 0.982 |
Respiratory Toxicity: | 0.937 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000305 | ![]() |
0.435 | D02YYF | ![]() |
0.352 | ||
ENC000407 | ![]() |
0.370 | D0G1OZ | ![]() |
0.268 | ||
ENC000733 | ![]() |
0.360 | D06LYG | ![]() |
0.262 | ||
ENC000754 | ![]() |
0.320 | D0U0RZ | ![]() |
0.259 | ||
ENC005498 | ![]() |
0.320 | D0P6UB | ![]() |
0.255 | ||
ENC001315 | ![]() |
0.308 | D0T3NY | ![]() |
0.254 | ||
ENC000179 | ![]() |
0.304 | D0B7OD | ![]() |
0.254 | ||
ENC001151 | ![]() |
0.300 | D05BMG | ![]() |
0.245 | ||
ENC000365 | ![]() |
0.300 | D0T3LF | ![]() |
0.245 | ||
ENC000823 | ![]() |
0.298 | D05OIS | ![]() |
0.245 |