![]() |
Name |
2-Hydroxyphenethyl alcohol
|
Molecular Formula | C8H10O2 | |
IUPAC Name* |
2-(2-hydroxyethyl)phenol
|
|
SMILES |
C1=CC=C(C(=C1)CCO)O
|
|
InChI |
InChI=1S/C8H10O2/c9-6-5-7-3-1-2-4-8(7)10/h1-4,9-10H,5-6H2
|
|
InChIKey |
ABFCOJLLBHXNOU-UHFFFAOYSA-N
|
|
Synonyms |
2-(2-Hydroxyethyl)phenol; 2-Hydroxyphenethyl alcohol; 7768-28-7; 2-Hydroxyphenylethanol; 2-(2-Hydroxyphenyl)ethanol; Benzeneethanol, 2-hydroxy-; 2-Hydroxybenzeneethanol; o-(2-Hydroxyethyl)phenol; o-Hydroxyphenethyl alcohol; 2-(o-Hydroxyphenyl)ethanol; 2-hydroxy-benzeneethanol; NSC 101845; C6AV79GN9F; beta-(o-Hydroxyphenyl)ethanol; MFCD00002890; NSC-101845; 2-phenolethanol; EINECS 231-863-3; 2-Hydroxyethylphenol; UNII-C6AV79GN9F; SCHEMBL43837; 2-(2-hydroxy-ethyl)-phenol; 2-(2-hydroxyphenyl)-ethanol; Phenethyl alcohol, o-hydroxy-; CHEMBL4075005; .beta.-(o-Hydroxyphenyl)ethanol; CHEBI:64803; DTXSID90228312; 2-Hydroxyphenethyl alcohol, 99%; 2-(2-Hydroxyethyl)phenol, 95%; ZINC406927; ACT04258; AMY37713; NSC101845; AKOS005259862; AB17761; CS-W016503; AS-10136; SY066615; DB-075363; FT-0648868; EN300-179020; 768H287; W-104304; Q27133443
|
|
CAS | 7768-28-7 | |
PubChem CID | 82200 | |
ChEMBL ID | CHEMBL4075005 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 138.16 | ALogp: | 1.2 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.647 |
Caco-2 Permeability: | -4.28 | MDCK Permeability: | 0.00002080 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.154 | 20% Bioavailability (F20%): | 0.977 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.151 | Plasma Protein Binding (PPB): | 38.00% |
Volume Distribution (VD): | 2.63 | Fu: | 46.33% |
CYP1A2-inhibitor: | 0.565 | CYP1A2-substrate: | 0.553 |
CYP2C19-inhibitor: | 0.117 | CYP2C19-substrate: | 0.145 |
CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.5 |
CYP2D6-inhibitor: | 0.081 | CYP2D6-substrate: | 0.633 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.247 |
Clearance (CL): | 13 | Half-life (T1/2): | 0.919 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.037 |
Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.222 |
Rat Oral Acute Toxicity: | 0.395 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.854 | Carcinogencity: | 0.502 |
Eye Corrosion: | 0.947 | Eye Irritation: | 0.993 |
Respiratory Toxicity: | 0.042 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005498 | ![]() |
1.000 | D07HBX | ![]() |
0.447 | ||
ENC000409 | ![]() |
0.568 | D05OIS | ![]() |
0.378 | ||
ENC000021 | ![]() |
0.515 | D0A5CM | ![]() |
0.344 | ||
ENC000128 | ![]() |
0.500 | D02YYF | ![]() |
0.340 | ||
ENC000363 | ![]() |
0.500 | D0P9AC | ![]() |
0.326 | ||
ENC000756 | ![]() |
0.474 | D0F5ZM | ![]() |
0.321 | ||
ENC000028 | ![]() |
0.471 | D0T7OW | ![]() |
0.318 | ||
ENC003028 | ![]() |
0.452 | D06BQU | ![]() |
0.297 | ||
ENC001315 | ![]() |
0.450 | D0P2GK | ![]() |
0.286 | ||
ENC000350 | ![]() |
0.436 | D03UOT | ![]() |
0.282 |