![]() |
Name |
1,2-Diethylbenzene
|
Molecular Formula | C10H14 | |
IUPAC Name* |
1,2-diethylbenzene
|
|
SMILES |
CCC1=CC=CC=C1CC
|
|
InChI |
InChI=1S/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3
|
|
InChIKey |
KVNYFPKFSJIPBJ-UHFFFAOYSA-N
|
|
Synonyms |
1,2-DIETHYLBENZENE; 135-01-3; o-Diethylbenzene; Benzene, 1,2-diethyl-; Benzene, diethyl-; Benzene, o-diethyl-; 1,2-diethyl-benzene; 25HOX6T1LU; Diethylbenzol; DSSTox_CID_7866; DSSTox_RID_78595; DSSTox_GSID_27866; CAS-25340-17-4; HSDB 4081; EINECS 205-170-1; UNII-25HOX6T1LU; BRN 1904392; diethyl benzene; ortho-Diethylbenzene; 3,4-diethylbenzene; EINECS 246-874-9; MFCD00792900; UN2049; 1,2-DiethyIbenzene; 1,2-diethyl benzene; NSC 405068; BRN 1903396; AI3-15336; 4-05-00-01065 (Beilstein Handbook Reference); BIDD:ER0356; CHEMBL3186870; DTXSID6052742; UNII-9A18Z78Q73; 1,2-DIETHYLBENZENE [HSDB]; ZINC2013553; Tox21_202258; Tox21_303467; MFCD00009258; AKOS015888421; 9A18Z78Q73; NCGC00257453-01; NCGC00259807-01; 1,2-Diethylbenzene, >=99.0% (GC); LS-13808; 1,2-Diethylbenzene, technical grade, 92%; DB-042262; FT-0606393; FT-0624880; 1,2-Diethylbenzene 100 microg/mL in Methanol; Diethylbenzene [UN2049] [Flammable liquid]; EC 246-874-9; EN300-112423; 4-05-00-01067 (Beilstein Handbook Reference); A806866; J-503819; Q2429316
|
|
CAS | 135-01-3 | |
PubChem CID | 8657 | |
ChEMBL ID | CHEMBL3186870 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 134.22 | ALogp: | 3.7 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.579 |
Caco-2 Permeability: | -4.269 | MDCK Permeability: | 0.00002300 |
Pgp-inhibitor: | 0.021 | Pgp-substrate: | 0.02 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.378 |
30% Bioavailability (F30%): | 0.901 |
Blood-Brain-Barrier Penetration (BBB): | 0.819 | Plasma Protein Binding (PPB): | 95.60% |
Volume Distribution (VD): | 2.031 | Fu: | 3.42% |
CYP1A2-inhibitor: | 0.979 | CYP1A2-substrate: | 0.92 |
CYP2C19-inhibitor: | 0.732 | CYP2C19-substrate: | 0.343 |
CYP2C9-inhibitor: | 0.389 | CYP2C9-substrate: | 0.212 |
CYP2D6-inhibitor: | 0.537 | CYP2D6-substrate: | 0.522 |
CYP3A4-inhibitor: | 0.084 | CYP3A4-substrate: | 0.351 |
Clearance (CL): | 9.4 | Half-life (T1/2): | 0.468 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.025 |
Drug-inuced Liver Injury (DILI): | 0.066 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.058 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.262 | Carcinogencity: | 0.309 |
Eye Corrosion: | 0.965 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.069 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000407 | ![]() |
0.606 | D02YYF | ![]() |
0.432 | ||
ENC003071 | ![]() |
0.435 | D0B7OD | ![]() |
0.327 | ||
ENC000203 | ![]() |
0.417 | D0U0RZ | ![]() |
0.318 | ||
ENC005498 | ![]() |
0.400 | D0P6UB | ![]() |
0.311 | ||
ENC000222 | ![]() |
0.400 | D06LYG | ![]() |
0.309 | ||
ENC000754 | ![]() |
0.400 | D05OIS | ![]() |
0.308 | ||
ENC000179 | ![]() |
0.389 | D05BMG | ![]() |
0.302 | ||
ENC000217 | ![]() |
0.385 | D0T3LF | ![]() |
0.302 | ||
ENC001315 | ![]() |
0.381 | D0T3NY | ![]() |
0.302 | ||
ENC000823 | ![]() |
0.362 | D0G1OZ | ![]() |
0.298 |