|
Name |
Chartarlactam B
|
| Molecular Formula | C28H39NO6 | |
| IUPAC Name* |
5-[(3R,4aS,7R,8R,8aS)-3,4'-dihydroxy-4,4,7,8a-tetramethyl-6'-oxospiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3,8-dihydrofuro[2,3-e]isoindole]-7'-yl]pentanoic acid
|
|
| SMILES |
C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CN(C5=O)CCCCC(=O)O)O)(CC[C@H](C2(C)C)O)C
|
|
| InChI |
InChI=1S/C28H39NO6/c1-16-8-9-21-26(2,3)22(31)10-11-27(21,4)28(16)14-18-20(30)13-17-19(24(18)35-28)15-29(25(17)34)12-6-5-7-23(32)33/h13,16,21-22,30-31H,5-12,14-15H2,1-4H3,(H,32,33)/t16-,21+,22-,27+,28-/m1/s1
|
|
| InChIKey |
OPCQWQMQPFYESC-SELUXCBJSA-N
|
|
| Synonyms |
Chartarlactam B; CHEMBL3104965
|
|
| CAS | NA | |
| PubChem CID | 76335578 | |
| ChEMBL ID | CHEMBL3104965 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 485.6 | ALogp: | 4.1 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 35 | QED Weighted: | 0.507 |
| Caco-2 Permeability: | -5.631 | MDCK Permeability: | 0.00000825 |
| Pgp-inhibitor: | 0.625 | Pgp-substrate: | 0.669 |
| Human Intestinal Absorption (HIA): | 0.035 | 20% Bioavailability (F20%): | 0.837 |
| 30% Bioavailability (F30%): | 0.644 |
| Blood-Brain-Barrier Penetration (BBB): | 0.044 | Plasma Protein Binding (PPB): | 95.37% |
| Volume Distribution (VD): | 0.363 | Fu: | 4.88% |
| CYP1A2-inhibitor: | 0.07 | CYP1A2-substrate: | 0.571 |
| CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.215 |
| CYP2C9-inhibitor: | 0.375 | CYP2C9-substrate: | 0.812 |
| CYP2D6-inhibitor: | 0.054 | CYP2D6-substrate: | 0.197 |
| CYP3A4-inhibitor: | 0.046 | CYP3A4-substrate: | 0.066 |
| Clearance (CL): | 6.397 | Half-life (T1/2): | 0.685 |
| hERG Blockers: | 0.077 | Human Hepatotoxicity (H-HT): | 0.324 |
| Drug-inuced Liver Injury (DILI): | 0.081 | AMES Toxicity: | 0.113 |
| Rat Oral Acute Toxicity: | 0.574 | Maximum Recommended Daily Dose: | 0.957 |
| Skin Sensitization: | 0.621 | Carcinogencity: | 0.228 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.085 |
| Respiratory Toxicity: | 0.907 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002992 | ![]() |
0.810 | D00AEQ | ![]() |
0.282 | ||
| ENC002034 | ![]() |
0.810 | D03SXE | ![]() |
0.253 | ||
| ENC003008 | ![]() |
0.676 | D04GJN | ![]() |
0.252 | ||
| ENC001965 | ![]() |
0.649 | D0I2SD | ![]() |
0.252 | ||
| ENC005396 | ![]() |
0.648 | D0R7JT | ![]() |
0.252 | ||
| ENC002673 | ![]() |
0.648 | D0IX6I | ![]() |
0.246 | ||
| ENC003020 | ![]() |
0.648 | D0KR5B | ![]() |
0.246 | ||
| ENC005398 | ![]() |
0.632 | D0M4WA | ![]() |
0.245 | ||
| ENC003552 | ![]() |
0.606 | D05RXI | ![]() |
0.243 | ||
| ENC002995 | ![]() |
0.587 | D04VIS | ![]() |
0.242 | ||