![]() |
Name |
Chartarlactam M
|
Molecular Formula | C23H31NO4 | |
IUPAC Name* |
(3R,4aS,7S,8R,8aS)-3,4'-dihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-7,8-dihydro-3H-furo[2,3-e]isoindole]-6'-one
|
|
SMILES |
C[C@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CNC5=O)O)(CC[C@H](C2(C)C)O)C
|
|
InChI |
InChI=1S/C23H31NO4/c1-12-5-6-17-21(2,3)18(26)7-8-22(17,4)23(12)10-14-16(25)9-13-15(19(14)28-23)11-24-20(13)27/h9,12,17-18,25-26H,5-8,10-11H2,1-4H3,(H,24,27)/t12-,17-,18+,22-,23+/m0/s1
|
|
InChIKey |
ZSVLMDBFFSSVAK-KIPYWULKSA-N
|
|
Synonyms |
Chartarlactam M; CHEMBL3104970
|
|
CAS | NA | |
PubChem CID | 76335579 | |
ChEMBL ID | CHEMBL3104970 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 385.5 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 78.8 | Aromatic Rings: | 5 |
Heavy Atoms: | 28 | QED Weighted: | 0.623 |
Caco-2 Permeability: | -4.93 | MDCK Permeability: | 0.00000963 |
Pgp-inhibitor: | 0.191 | Pgp-substrate: | 0.963 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.869 |
30% Bioavailability (F30%): | 0.049 |
Blood-Brain-Barrier Penetration (BBB): | 0.244 | Plasma Protein Binding (PPB): | 89.00% |
Volume Distribution (VD): | 1.572 | Fu: | 14.15% |
CYP1A2-inhibitor: | 0.524 | CYP1A2-substrate: | 0.659 |
CYP2C19-inhibitor: | 0.152 | CYP2C19-substrate: | 0.354 |
CYP2C9-inhibitor: | 0.626 | CYP2C9-substrate: | 0.881 |
CYP2D6-inhibitor: | 0.745 | CYP2D6-substrate: | 0.604 |
CYP3A4-inhibitor: | 0.388 | CYP3A4-substrate: | 0.27 |
Clearance (CL): | 12.314 | Half-life (T1/2): | 0.378 |
hERG Blockers: | 0.051 | Human Hepatotoxicity (H-HT): | 0.524 |
Drug-inuced Liver Injury (DILI): | 0.034 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.98 | Maximum Recommended Daily Dose: | 0.966 |
Skin Sensitization: | 0.908 | Carcinogencity: | 0.135 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.254 |
Respiratory Toxicity: | 0.944 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005396 | ![]() |
1.000 | D0L2LS | ![]() |
0.279 | ||
ENC003014 | ![]() |
0.826 | D0Z1XD | ![]() |
0.278 | ||
ENC002995 | ![]() |
0.812 | D0Q6NZ | ![]() |
0.277 | ||
ENC003789 | ![]() |
0.812 | D03XOC | ![]() |
0.274 | ||
ENC003009 | ![]() |
0.773 | D0U3GL | ![]() |
0.266 | ||
ENC003552 | ![]() |
0.753 | D0I2SD | ![]() |
0.261 | ||
ENC002994 | ![]() |
0.750 | D04GJN | ![]() |
0.261 | ||
ENC002034 | ![]() |
0.723 | D08QKJ | ![]() |
0.261 | ||
ENC003259 | ![]() |
0.708 | D04VIS | ![]() |
0.250 | ||
ENC003008 | ![]() |
0.653 | D06XMU | ![]() |
0.248 |