|
Name |
Chartarlactam N
|
| Molecular Formula | C25H35NO5 | |
| IUPAC Name* |
(3R,4aS,7S,8R,8aS)-3,4'-dihydroxy-7'-(2-hydroxyethyl)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3,8-dihydrofuro[2,3-e]isoindole]-6'-one
|
|
| SMILES |
C[C@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CN(C5=O)CCO)O)(CC[C@H](C2(C)C)O)C
|
|
| InChI |
InChI=1S/C25H35NO5/c1-14-5-6-19-23(2,3)20(29)7-8-24(19,4)25(14)12-16-18(28)11-15-17(21(16)31-25)13-26(9-10-27)22(15)30/h11,14,19-20,27-29H,5-10,12-13H2,1-4H3/t14-,19-,20+,24-,25+/m0/s1
|
|
| InChIKey |
ZHECNBLIOXZXBL-FVFQVNOOSA-N
|
|
| Synonyms |
Chartarlactam N; CHEMBL3104993
|
|
| CAS | NA | |
| PubChem CID | 73890962 | |
| ChEMBL ID | CHEMBL3104993 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 429.5 | ALogp: | 3.2 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 90.2 | Aromatic Rings: | 5 |
| Heavy Atoms: | 31 | QED Weighted: | 0.661 |
| Caco-2 Permeability: | -5.056 | MDCK Permeability: | 0.00001180 |
| Pgp-inhibitor: | 0.403 | Pgp-substrate: | 0.957 |
| Human Intestinal Absorption (HIA): | 0.094 | 20% Bioavailability (F20%): | 0.938 |
| 30% Bioavailability (F30%): | 0.183 |
| Blood-Brain-Barrier Penetration (BBB): | 0.96 | Plasma Protein Binding (PPB): | 71.34% |
| Volume Distribution (VD): | 2.617 | Fu: | 22.03% |
| CYP1A2-inhibitor: | 0.204 | CYP1A2-substrate: | 0.491 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.536 |
| CYP2C9-inhibitor: | 0.386 | CYP2C9-substrate: | 0.625 |
| CYP2D6-inhibitor: | 0.112 | CYP2D6-substrate: | 0.292 |
| CYP3A4-inhibitor: | 0.17 | CYP3A4-substrate: | 0.228 |
| Clearance (CL): | 11.058 | Half-life (T1/2): | 0.361 |
| hERG Blockers: | 0.051 | Human Hepatotoxicity (H-HT): | 0.372 |
| Drug-inuced Liver Injury (DILI): | 0.045 | AMES Toxicity: | 0.445 |
| Rat Oral Acute Toxicity: | 0.837 | Maximum Recommended Daily Dose: | 0.955 |
| Skin Sensitization: | 0.9 | Carcinogencity: | 0.639 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.123 |
| Respiratory Toxicity: | 0.914 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002034 | ![]() |
1.000 | D04VIS | ![]() |
0.275 | ||
| ENC003008 | ![]() |
0.828 | D0L2LS | ![]() |
0.261 | ||
| ENC003019 | ![]() |
0.810 | D0Z1XD | ![]() |
0.259 | ||
| ENC001965 | ![]() |
0.792 | D0Q6NZ | ![]() |
0.258 | ||
| ENC005396 | ![]() |
0.723 | D03XOC | ![]() |
0.256 | ||
| ENC003552 | ![]() |
0.657 | D0R7JT | ![]() |
0.254 | ||
| ENC003789 | ![]() |
0.653 | D0IX6I | ![]() |
0.248 | ||
| ENC002995 | ![]() |
0.653 | D0KR5B | ![]() |
0.248 | ||
| ENC003014 | ![]() |
0.650 | D0U3GL | ![]() |
0.248 | ||
| ENC005398 | ![]() |
0.636 | D04GJN | ![]() |
0.244 | ||