|
Name |
Chartarlactam C
|
| Molecular Formula | C23H31NO5 | |
| IUPAC Name* |
(3R,4R,4aS,7R,8R,8aS)-3,4'-dihydroxy-4-(hydroxymethyl)-4,7,8a-trimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-7,8-dihydro-3H-furo[2,3-e]isoindole]-6'-one
|
|
| SMILES |
C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CNC5=O)O)(CC[C@H]([C@@]2(C)CO)O)C
|
|
| InChI |
InChI=1S/C23H31NO5/c1-12-4-5-17-21(2,11-25)18(27)6-7-22(17,3)23(12)9-14-16(26)8-13-15(19(14)29-23)10-24-20(13)28/h8,12,17-18,25-27H,4-7,9-11H2,1-3H3,(H,24,28)/t12-,17+,18-,21+,22+,23-/m1/s1
|
|
| InChIKey |
UKFJJQFTYRFTPB-MLQVOUEBSA-N
|
|
| Synonyms |
Chartarlactam C; CHEMBL3104966
|
|
| CAS | NA | |
| PubChem CID | 76321121 | |
| ChEMBL ID | CHEMBL3104966 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 401.5 | ALogp: | 3.1 |
| HBD: | 4 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 99.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 29 | QED Weighted: | 0.579 |
| Caco-2 Permeability: | -5.202 | MDCK Permeability: | 0.00000453 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.978 |
| Human Intestinal Absorption (HIA): | 0.2 | 20% Bioavailability (F20%): | 0.854 |
| 30% Bioavailability (F30%): | 0.476 |
| Blood-Brain-Barrier Penetration (BBB): | 0.332 | Plasma Protein Binding (PPB): | 92.21% |
| Volume Distribution (VD): | 1.076 | Fu: | 14.13% |
| CYP1A2-inhibitor: | 0.474 | CYP1A2-substrate: | 0.597 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.33 |
| CYP2C9-inhibitor: | 0.169 | CYP2C9-substrate: | 0.437 |
| CYP2D6-inhibitor: | 0.374 | CYP2D6-substrate: | 0.346 |
| CYP3A4-inhibitor: | 0.376 | CYP3A4-substrate: | 0.179 |
| Clearance (CL): | 10.28 | Half-life (T1/2): | 0.761 |
| hERG Blockers: | 0.107 | Human Hepatotoxicity (H-HT): | 0.603 |
| Drug-inuced Liver Injury (DILI): | 0.094 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.972 | Maximum Recommended Daily Dose: | 0.971 |
| Skin Sensitization: | 0.918 | Carcinogencity: | 0.046 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.148 |
| Respiratory Toxicity: | 0.927 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003020 | ![]() |
0.826 | D04VIS | ![]() |
0.333 | ||
| ENC002673 | ![]() |
0.826 | D03XOC | ![]() |
0.267 | ||
| ENC005396 | ![]() |
0.826 | D0R7JT | ![]() |
0.264 | ||
| ENC001975 | ![]() |
0.691 | D0L2LS | ![]() |
0.261 | ||
| ENC003017 | ![]() |
0.691 | D0Z1XD | ![]() |
0.259 | ||
| ENC003009 | ![]() |
0.691 | D0Q6NZ | ![]() |
0.259 | ||
| ENC002994 | ![]() |
0.688 | D0IX6I | ![]() |
0.258 | ||
| ENC003789 | ![]() |
0.670 | D0KR5B | ![]() |
0.258 | ||
| ENC002996 | ![]() |
0.670 | D0IT2G | ![]() |
0.250 | ||
| ENC002995 | ![]() |
0.670 | D0CW1P | ![]() |
0.250 | ||