|
Name |
Asperamide B
|
| Molecular Formula | C43H79NO9 | |
| IUPAC Name* |
(E,2R)-2-hydroxy-N-[(2S,3R,4E,8E)-3-hydroxy-9-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyicosa-4,8-dien-2-yl]hexadec-3-enamide
|
|
| SMILES |
CCCCCCCCCCCC/C=C/[C@H](C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H](/C=C/CC/C=C(\C)/CCCCCCCCCCC)O)O
|
|
| InChI |
InChI=1S/C43H79NO9/c1-4-6-8-10-12-14-15-16-18-20-22-26-31-37(47)42(51)44-35(33-52-43-41(50)40(49)39(48)38(32-45)53-43)36(46)30-27-23-25-29-34(3)28-24-21-19-17-13-11-9-7-5-2/h26-27,29-31,35-41,43,45-50H,4-25,28,32-33H2,1-3H3,(H,44,51)/b30-27+,31-26+,34-29+/t35-,36+,37+,38+,39+,40-,41+,43+/m0/s1
|
|
| InChIKey |
URILDRUQSTUFPC-DDSPGNMTSA-N
|
|
| Synonyms |
Asperamide B; CHEBI:70017; Q27138358; (2R,3E)-N-[(2S,3R,4E,8E)-1-(beta-D-glucopyranosyloxy)-3-hydroxy-9-methylicosa-4,8-dien-2-yl]-2-hydroxyhexadec-3-enamide
|
|
| CAS | NA | |
| PubChem CID | 70698249 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 754.1 | ALogp: | 11.0 |
| HBD: | 7 | HBA: | 9 |
| Rotatable Bonds: | 33 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 169.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 53 | QED Weighted: | 0.027 |
| Caco-2 Permeability: | -5.421 | MDCK Permeability: | 0.00000679 |
| Pgp-inhibitor: | 0.052 | Pgp-substrate: | 0.243 |
| Human Intestinal Absorption (HIA): | 0.897 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.023 | Plasma Protein Binding (PPB): | 96.11% |
| Volume Distribution (VD): | 1.003 | Fu: | 1.44% |
| CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.101 |
| CYP2C19-inhibitor: | 0.246 | CYP2C19-substrate: | 0.041 |
| CYP2C9-inhibitor: | 0.111 | CYP2C9-substrate: | 0.991 |
| CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.017 |
| CYP3A4-inhibitor: | 0.181 | CYP3A4-substrate: | 0.006 |
| Clearance (CL): | 2.396 | Half-life (T1/2): | 0.192 |
| hERG Blockers: | 0.407 | Human Hepatotoxicity (H-HT): | 0.179 |
| Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.033 |
| Skin Sensitization: | 0.965 | Carcinogencity: | 0.008 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.021 |
| Respiratory Toxicity: | 0.169 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005817 | ![]() |
1.000 | D00STJ | ![]() |
0.445 | ||
| ENC002194 | ![]() |
1.000 | D06KDP | ![]() |
0.382 | ||
| ENC003750 | ![]() |
0.851 | D00AOJ | ![]() |
0.367 | ||
| ENC005011 | ![]() |
0.763 | D01NTX | ![]() |
0.352 | ||
| ENC003604 | ![]() |
0.763 | D0Z1QC | ![]() |
0.352 | ||
| ENC005852 | ![]() |
0.491 | D0O1PH | ![]() |
0.327 | ||
| ENC002672 | ![]() |
0.468 | D07ILQ | ![]() |
0.323 | ||
| ENC001943 | ![]() |
0.461 | D0T9TJ | ![]() |
0.314 | ||
| ENC001674 | ![]() |
0.452 | D00FGR | ![]() |
0.287 | ||
| ENC00491113 | ![]() |
0.435 | D03JSJ | ![]() |
0.276 | ||