|
Name |
Hydroxypalmitoyl sphinganine
|
| Molecular Formula | C34H69NO4 | |
| IUPAC Name* |
N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]-2-hydroxyhexadecanamide
|
|
| SMILES |
CCCCCCCCCCCCCCC[C@H]([C@H](CO)NC(=O)C(CCCCCCCCCCCCCC)O)O
|
|
| InChI |
InChI=1S/C34H69NO4/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-32(37)31(30-36)35-34(39)33(38)29-27-25-23-21-18-16-14-12-10-8-6-4-2/h31-33,36-38H,3-30H2,1-2H3,(H,35,39)/t31-,32+,33?/m0/s1
|
|
| InChIKey |
NQXMVCBJWMTLGK-XIWRNSNHSA-N
|
|
| Synonyms |
Hydroxypalmitoyl sphinganine; Mexanyl GAA; 190249-36-6; N-(2-hydroxyhexadecanoyl)-sphinganine; Cer(d18:0/16:0(2OH)); NR33W2353T; N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]-2-hydroxyhexadecanamide; Hexadecanamide, 2-hydroxy-N-((1S,2R)-2-hydroxy-1-(hydroxymethyl)heptadecyl)-; Hexadecanamide, 2-hydroxy-N-(2-hydroxy-1-(hydroxymethyl)heptadecyl)-, (1S-(1R*,2S*))-(partial)-; 2-hydroxy-N-[(1S,2R)-2-hydroxy-1-(hydroxymethyl)heptadecyl]-hexadecanamide; UNII-NR33W2353T; Ceramid 5; SCHEMBL1479823; CHEBI:67043; DTXSID90172503; N-(2-hydroxyhexadecanoyl)sphinganine; LMSP02020029; N-(2-hydroxyhexadecanoyl)dihydroceramide; DHC-B' 18:0/16:0; HYDROXYPALMITOYL SPHINGANINE [INCI]; N-(2-hydroxyhexadecanoyl)dihydrosphingosine; Q27135601
|
|
| CAS | 190249-36-6 | |
| PubChem CID | 9959390 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 555.9 | ALogp: | 12.6 |
| HBD: | 4 | HBA: | 4 |
| Rotatable Bonds: | 31 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 89.8 | Aromatic Rings: | 0 |
| Heavy Atoms: | 39 | QED Weighted: | 0.058 |
| Caco-2 Permeability: | -5.249 | MDCK Permeability: | 0.00000561 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.885 |
| Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.84 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 98.73% |
| Volume Distribution (VD): | 0.842 | Fu: | 1.50% |
| CYP1A2-inhibitor: | 0.048 | CYP1A2-substrate: | 0.155 |
| CYP2C19-inhibitor: | 0.12 | CYP2C19-substrate: | 0.04 |
| CYP2C9-inhibitor: | 0.055 | CYP2C9-substrate: | 0.987 |
| CYP2D6-inhibitor: | 0.094 | CYP2D6-substrate: | 0.026 |
| CYP3A4-inhibitor: | 0.203 | CYP3A4-substrate: | 0.012 |
| Clearance (CL): | 4.228 | Half-life (T1/2): | 0.111 |
| hERG Blockers: | 0.573 | Human Hepatotoxicity (H-HT): | 0.05 |
| Drug-inuced Liver Injury (DILI): | 0.027 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.005 | Maximum Recommended Daily Dose: | 0.008 |
| Skin Sensitization: | 0.96 | Carcinogencity: | 0.013 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.424 |
| Respiratory Toxicity: | 0.787 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006082 | ![]() |
0.784 | D00AOJ | ![]() |
0.561 | ||
| ENC000401 | ![]() |
0.681 | D00STJ | ![]() |
0.433 | ||
| ENC000435 | ![]() |
0.678 | D07ILQ | ![]() |
0.402 | ||
| ENC000436 | ![]() |
0.675 | D0Z1QC | ![]() |
0.391 | ||
| ENC000443 | ![]() |
0.672 | D01NTX | ![]() |
0.373 | ||
| ENC000434 | ![]() |
0.670 | D0T9TJ | ![]() |
0.348 | ||
| ENC000433 | ![]() |
0.658 | D00FGR | ![]() |
0.348 | ||
| ENC000437 | ![]() |
0.656 | D0O1PH | ![]() |
0.321 | ||
| ENC000381 | ![]() |
0.640 | D0Z5SM | ![]() |
0.310 | ||
| ENC001125 | ![]() |
0.639 | D06KDP | ![]() |
0.296 | ||