|
Name |
2-(21-Amino-3,20-dihydroxydocosan-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol
|
| Molecular Formula | C28H57NO8 | |
| IUPAC Name* |
2-(21-amino-3,20-dihydroxydocosan-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
| SMILES |
CC(C(CCCCCCCCCCCCCCCCC(C(C)OC1C(C(C(C(O1)CO)O)O)O)O)O)N
|
|
| InChI |
InChI=1S/C28H57NO8/c1-20(29)22(31)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-23(32)21(2)36-28-27(35)26(34)25(33)24(19-30)37-28/h20-28,30-35H,3-19,29H2,1-2H3
|
|
| InChIKey |
FZSYYVOKNJZJTF-UHFFFAOYSA-N
|
|
| Synonyms |
NCGC00347555-02!2-(21-amino-3,20-dihydroxydocosan-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
| CAS | NA | |
| PubChem CID | 45359385 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 535.8 | ALogp: | 4.6 |
| HBD: | 7 | HBA: | 9 |
| Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 166.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 37 | QED Weighted: | 0.103 |
| Caco-2 Permeability: | -5.471 | MDCK Permeability: | 0.00002670 |
| Pgp-inhibitor: | 0.041 | Pgp-substrate: | 0.064 |
| Human Intestinal Absorption (HIA): | 0.978 | 20% Bioavailability (F20%): | 0.908 |
| 30% Bioavailability (F30%): | 0.934 |
| Blood-Brain-Barrier Penetration (BBB): | 0.053 | Plasma Protein Binding (PPB): | 90.50% |
| Volume Distribution (VD): | 0.685 | Fu: | 4.67% |
| CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.065 |
| CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.052 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.781 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.121 |
| CYP3A4-inhibitor: | 0.025 | CYP3A4-substrate: | 0.02 |
| Clearance (CL): | 2.119 | Half-life (T1/2): | 0.16 |
| hERG Blockers: | 0.258 | Human Hepatotoxicity (H-HT): | 0.078 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0.212 |
| Rat Oral Acute Toxicity: | 0.048 | Maximum Recommended Daily Dose: | 0.009 |
| Skin Sensitization: | 0.326 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.907 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005852 | ![]() |
0.664 | D00STJ | ![]() |
0.412 | ||
| ENC002194 | ![]() |
0.468 | D00AOJ | ![]() |
0.374 | ||
| ENC002909 | ![]() |
0.468 | D07ILQ | ![]() |
0.339 | ||
| ENC005817 | ![]() |
0.468 | D00FGR | ![]() |
0.331 | ||
| ENC004781 | ![]() |
0.462 | D0T9TJ | ![]() |
0.325 | ||
| ENC000666 | ![]() |
0.459 | D03JSJ | ![]() |
0.294 | ||
| ENC003750 | ![]() |
0.459 | D0Z5SM | ![]() |
0.289 | ||
| ENC004449 | ![]() |
0.455 | D0O1PH | ![]() |
0.282 | ||
| ENC000789 | ![]() |
0.450 | D01NTX | ![]() |
0.281 | ||
| ENC001124 | ![]() |
0.446 | D0P1RL | ![]() |
0.272 | ||