![]() |
Name |
Merulin A, (rel)-
|
Molecular Formula | C14H22O4 | |
IUPAC Name* |
(1S,6S,9S,10R)-10-hydroxy-2,2,6-trimethyl-7,8-dioxatricyclo[7.3.1.01,6]tridecan-5-one
|
|
SMILES |
C[C@@]12C(=O)CCC([C@@]13CC[C@H]([C@H](C3)OO2)O)(C)C
|
|
InChI |
InChI=1S/C14H22O4/c1-12(2)6-5-11(16)13(3)14(12)7-4-9(15)10(8-14)17-18-13/h9-10,15H,4-8H2,1-3H3/t9-,10+,13-,14+/m1/s1
|
|
InChIKey |
QYJVCFQEMCWLHS-QOBDMFJFSA-N
|
|
Synonyms |
Merulin A, (rel)-; merulin A; CHEBI:69047; Q27137388; 9-hydroxy-1,5,5-trimethyl-1,8-epidioxyspiro[5.5]decan-2-one
|
|
CAS | NA | |
PubChem CID | 70698059 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.32 | ALogp: | 1.6 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.675 |
Caco-2 Permeability: | -4.722 | MDCK Permeability: | 0.00001900 |
Pgp-inhibitor: | 0.042 | Pgp-substrate: | 0.195 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.233 |
Blood-Brain-Barrier Penetration (BBB): | 0.381 | Plasma Protein Binding (PPB): | 74.34% |
Volume Distribution (VD): | 1.151 | Fu: | 35.50% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.925 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.883 |
CYP2C9-inhibitor: | 0.031 | CYP2C9-substrate: | 0.197 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.26 |
CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.783 |
Clearance (CL): | 9.42 | Half-life (T1/2): | 0.631 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.613 |
Drug-inuced Liver Injury (DILI): | 0.284 | AMES Toxicity: | 0.888 |
Rat Oral Acute Toxicity: | 0.833 | Maximum Recommended Daily Dose: | 0.435 |
Skin Sensitization: | 0.465 | Carcinogencity: | 0.964 |
Eye Corrosion: | 0.672 | Eye Irritation: | 0.9 |
Respiratory Toxicity: | 0.976 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004436 | ![]() |
1.000 | D0H1QY | ![]() |
0.300 | ||
ENC004717 | ![]() |
0.607 | D0L2LS | ![]() |
0.295 | ||
ENC002907 | ![]() |
0.585 | D0U3GL | ![]() |
0.279 | ||
ENC003899 | ![]() |
0.417 | D0Z1XD | ![]() |
0.279 | ||
ENC003900 | ![]() |
0.386 | D0K0EK | ![]() |
0.271 | ||
ENC003901 | ![]() |
0.366 | D0KR5B | ![]() |
0.263 | ||
ENC004664 | ![]() |
0.333 | D04SFH | ![]() |
0.258 | ||
ENC002262 | ![]() |
0.333 | D06XMU | ![]() |
0.256 | ||
ENC005088 | ![]() |
0.328 | D04DJN | ![]() |
0.256 | ||
ENC002407 | ![]() |
0.324 | D06IIB | ![]() |
0.255 |