NPs Basic Information
|
Name |
Merulin A, (rel)-
|
| Molecular Formula | C14H22O4 | |
| IUPAC Name* |
(1S,6S,9S,10R)-10-hydroxy-2,2,6-trimethyl-7,8-dioxatricyclo[7.3.1.01,6]tridecan-5-one
|
|
| SMILES |
C[C@@]12C(=O)CCC([C@@]13CC[C@H]([C@H](C3)OO2)O)(C)C
|
|
| InChI |
InChI=1S/C14H22O4/c1-12(2)6-5-11(16)13(3)14(12)7-4-9(15)10(8-14)17-18-13/h9-10,15H,4-8H2,1-3H3/t9-,10+,13-,14+/m1/s1
|
|
| InChIKey |
QYJVCFQEMCWLHS-QOBDMFJFSA-N
|
|
| Synonyms |
Merulin A, (rel)-; merulin A; CHEBI:69047; Q27137388; 9-hydroxy-1,5,5-trimethyl-1,8-epidioxyspiro[5.5]decan-2-one
|
|
| CAS | NA | |
| PubChem CID | 70698059 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 254.32 | ALogp: | 1.6 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.8 | Aromatic Rings: | 3 |
| Heavy Atoms: | 18 | QED Weighted: | 0.675 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.722 | MDCK Permeability: | 0.00001900 |
| Pgp-inhibitor: | 0.042 | Pgp-substrate: | 0.195 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.02 |
| 30% Bioavailability (F30%): | 0.233 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.381 | Plasma Protein Binding (PPB): | 74.34% |
| Volume Distribution (VD): | 1.151 | Fu: | 35.50% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.925 |
| CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.883 |
| CYP2C9-inhibitor: | 0.031 | CYP2C9-substrate: | 0.197 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.26 |
| CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.783 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.42 | Half-life (T1/2): | 0.631 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.613 |
| Drug-inuced Liver Injury (DILI): | 0.284 | AMES Toxicity: | 0.888 |
| Rat Oral Acute Toxicity: | 0.833 | Maximum Recommended Daily Dose: | 0.435 |
| Skin Sensitization: | 0.465 | Carcinogencity: | 0.964 |
| Eye Corrosion: | 0.672 | Eye Irritation: | 0.9 |
| Respiratory Toxicity: | 0.976 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004436 |  |
1.000 | D0H1QY |  |
0.300 | ||
| ENC004717 |  |
0.607 | D0L2LS |  |
0.295 | ||
| ENC002907 |  |
0.585 | D0U3GL |  |
0.279 | ||
| ENC003899 |  |
0.417 | D0Z1XD |  |
0.279 | ||
| ENC003900 |  |
0.386 | D0K0EK |  |
0.271 | ||
| ENC003901 |  |
0.366 | D0KR5B |  |
0.263 | ||
| ENC004664 |  |
0.333 | D04SFH |  |
0.258 | ||
| ENC002262 |  |
0.333 | D06XMU |  |
0.256 | ||
| ENC005088 |  |
0.328 | D04DJN |  |
0.256 | ||
| ENC002407 |  |
0.324 | D06IIB |  |
0.255 | ||