![]() |
Name |
Phomomane
|
Molecular Formula | C15H26O3 | |
IUPAC Name* |
4,5-dihydroxy-4,8a-dimethyl-6-propan-2-yl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one
|
|
SMILES |
CC(C)C1CCC2(C)C(=O)CCC(C)(O)C2C1O
|
|
InChI |
InChI=1S/C15H26O3/c1-9(2)10-5-7-14(3)11(16)6-8-15(4,18)13(14)12(10)17/h9-10,12-13,17-18H,5-8H2,1-4H3/t10-,12-,13+,14-,15+/m1/s1
|
|
InChIKey |
TWXJOBQSLRCOQR-LFHLZQBKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.37 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.756 |
Caco-2 Permeability: | -4.568 | MDCK Permeability: | 0.00001940 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.245 |
30% Bioavailability (F30%): | 0.146 |
Blood-Brain-Barrier Penetration (BBB): | 0.974 | Plasma Protein Binding (PPB): | 73.77% |
Volume Distribution (VD): | 0.749 | Fu: | 29.73% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.532 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.913 |
CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.733 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.232 |
CYP3A4-inhibitor: | 0.064 | CYP3A4-substrate: | 0.449 |
Clearance (CL): | 14.595 | Half-life (T1/2): | 0.707 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.374 |
Drug-inuced Liver Injury (DILI): | 0.076 | AMES Toxicity: | 0.171 |
Rat Oral Acute Toxicity: | 0.219 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.039 | Carcinogencity: | 0.032 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
Respiratory Toxicity: | 0.473 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004915 | ![]() |
0.481 | D0K0EK | ![]() |
0.325 | ||
ENC003266 | ![]() |
0.481 | D04CSZ | ![]() |
0.310 | ||
ENC002017 | ![]() |
0.429 | D0H1QY | ![]() |
0.288 | ||
ENC005930 | ![]() |
0.415 | D0L2LS | ![]() |
0.287 | ||
ENC005929 | ![]() |
0.415 | D0Z1XD | ![]() |
0.286 | ||
ENC005928 | ![]() |
0.415 | D04GJN | ![]() |
0.278 | ||
ENC003050 | ![]() |
0.394 | D0I2SD | ![]() |
0.278 | ||
ENC003125 | ![]() |
0.385 | D06XMU | ![]() |
0.277 | ||
ENC002278 | ![]() |
0.382 | D01CKY | ![]() |
0.275 | ||
ENC001779 | ![]() |
0.373 | D0D2VS | ![]() |
0.271 |