![]() |
Name |
3Beta-Hydroxyconfertifolin
|
Molecular Formula | C15H22O3 | |
IUPAC Name* |
(5aR,7S,9aS)-7-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one
|
|
SMILES |
C[C@]12CC[C@@H](C([C@@H]1CCC3=C2COC3=O)(C)C)O
|
|
InChI |
InChI=1S/C15H22O3/c1-14(2)11-5-4-9-10(8-18-13(9)17)15(11,3)7-6-12(14)16/h11-12,16H,4-8H2,1-3H3/t11-,12-,15+/m0/s1
|
|
InChIKey |
AJWGJOBMBGXSSP-SLEUVZQESA-N
|
|
Synonyms |
3Beta-Hydroxyconfertifolin; CHEMBL2152466; (5aR)-6,6,9abeta-Trimethyl-7beta-hydroxy-1,3,4,5,5aalpha,6,7,8,9,9a-decahydronaphtho[1,2-c]furan-3-one
|
|
CAS | NA | |
PubChem CID | 21586435 | |
ChEMBL ID | CHEMBL2152466 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.33 | ALogp: | 2.3 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.671 |
Caco-2 Permeability: | -4.84 | MDCK Permeability: | 0.00001610 |
Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0.634 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.041 |
Blood-Brain-Barrier Penetration (BBB): | 0.269 | Plasma Protein Binding (PPB): | 91.73% |
Volume Distribution (VD): | 2.107 | Fu: | 15.76% |
CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.271 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.533 |
CYP2C9-inhibitor: | 0.143 | CYP2C9-substrate: | 0.755 |
CYP2D6-inhibitor: | 0.026 | CYP2D6-substrate: | 0.674 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.187 |
Clearance (CL): | 16.428 | Half-life (T1/2): | 0.616 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.178 |
Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.943 |
Skin Sensitization: | 0.315 | Carcinogencity: | 0.363 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.107 |
Respiratory Toxicity: | 0.964 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005461 | ![]() |
0.463 | D04VIS | ![]() |
0.360 | ||
ENC002941 | ![]() |
0.455 | D06XMU | ![]() |
0.301 | ||
ENC003682 | ![]() |
0.412 | D0K0EK | ![]() |
0.301 | ||
ENC002748 | ![]() |
0.400 | D0L2LS | ![]() |
0.295 | ||
ENC002920 | ![]() |
0.392 | D0Z1XD | ![]() |
0.294 | ||
ENC004580 | ![]() |
0.391 | D0G8BV | ![]() |
0.284 | ||
ENC004579 | ![]() |
0.391 | D0U3GL | ![]() |
0.279 | ||
ENC004578 | ![]() |
0.391 | D0D2VS | ![]() |
0.279 | ||
ENC004581 | ![]() |
0.391 | D0H1QY | ![]() |
0.279 | ||
ENC004582 | ![]() |
0.391 | D04GJN | ![]() |
0.272 |