|
Name |
Ergosta-5,7,22-trienol
|
| Molecular Formula | C28H44O | |
| IUPAC Name* |
(3S,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylhept-4-en-1-ol
|
|
| SMILES |
C[C@H](C=C[C@H](C)C(C)CO)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC=C4[C@@]3(CCCC4)C)C
|
|
| InChI |
InChI=1S/C28H44O/c1-19(21(3)18-29)9-10-20(2)24-13-14-25-23-12-11-22-8-6-7-16-27(22,4)26(23)15-17-28(24,25)5/h9-12,19-21,24-26,29H,6-8,13-18H2,1-5H3/t19-,20+,21?,24+,25-,26-,27-,28+/m0/s1
|
|
| InChIKey |
IDDKLJRXNNEEBX-AQGSFBQWSA-N
|
|
| Synonyms |
ergosta-5,7,22-trienol; SCHEMBL4145640
|
|
| CAS | NA | |
| PubChem CID | 68930746 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 396.6 | ALogp: | 7.7 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.48 |
| Caco-2 Permeability: | -4.758 | MDCK Permeability: | 0.00000640 |
| Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.954 |
| 30% Bioavailability (F30%): | 0.879 |
| Blood-Brain-Barrier Penetration (BBB): | 0.091 | Plasma Protein Binding (PPB): | 97.66% |
| Volume Distribution (VD): | 2.505 | Fu: | 1.08% |
| CYP1A2-inhibitor: | 0.142 | CYP1A2-substrate: | 0.444 |
| CYP2C19-inhibitor: | 0.073 | CYP2C19-substrate: | 0.95 |
| CYP2C9-inhibitor: | 0.178 | CYP2C9-substrate: | 0.086 |
| CYP2D6-inhibitor: | 0.08 | CYP2D6-substrate: | 0.35 |
| CYP3A4-inhibitor: | 0.648 | CYP3A4-substrate: | 0.906 |
| Clearance (CL): | 1.569 | Half-life (T1/2): | 0.094 |
| hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.041 |
| Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.515 | Maximum Recommended Daily Dose: | 0.95 |
| Skin Sensitization: | 0.827 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.01 | Eye Irritation: | 0.57 |
| Respiratory Toxicity: | 0.944 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001092 | ![]() |
0.677 | D0G8OC | ![]() |
0.438 | ||
| ENC004738 | ![]() |
0.677 | D06JPB | ![]() |
0.438 | ||
| ENC005707 | ![]() |
0.677 | D0G5CF | ![]() |
0.405 | ||
| ENC005258 | ![]() |
0.660 | D0N1TP | ![]() |
0.370 | ||
| ENC005238 | ![]() |
0.640 | D0K5WS | ![]() |
0.336 | ||
| ENC002665 | ![]() |
0.594 | D01QUS | ![]() |
0.333 | ||
| ENC005270 | ![]() |
0.552 | D0Y7LD | ![]() |
0.333 | ||
| ENC004803 | ![]() |
0.540 | D08SVH | ![]() |
0.315 | ||
| ENC003120 | ![]() |
0.523 | D02ZGI | ![]() |
0.304 | ||
| ENC004906 | ![]() |
0.523 | D02VPX | ![]() |
0.298 | ||