|
Name |
(1S,2R,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadeca-6,10-diene-5,9-dione
|
| Molecular Formula | C28H40O3 | |
| IUPAC Name* |
(1S,2R,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadeca-6,10-diene-5,9-dione
|
|
| SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC(=O)OC4=CC(=O)CC[C@]34C)C
|
|
| InChI |
InChI=1S/C28H40O3/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-16-26(30)31-25-15-20(29)11-13-28(25,6)24(21)12-14-27(22,23)5/h7-8,15-19,22-24H,9-14H2,1-6H3/b8-7+/t18-,19+,22+,23-,24-,27+,28+/m0/s1
|
|
| InChIKey |
ZBDCBYOOVMXUHB-IXWATKSXSA-N
|
|
| Synonyms |
Herbarulide
|
|
| CAS | NA | |
| PubChem CID | 100936600 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 424.6 | ALogp: | 6.5 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 43.4 | Aromatic Rings: | 4 |
| Heavy Atoms: | 31 | QED Weighted: | 0.378 |
| Caco-2 Permeability: | -4.996 | MDCK Permeability: | 0.00002080 |
| Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.004 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.87 |
| 30% Bioavailability (F30%): | 0.914 |
| Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 85.87% |
| Volume Distribution (VD): | 1.155 | Fu: | 1.58% |
| CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.411 |
| CYP2C19-inhibitor: | 0.445 | CYP2C19-substrate: | 0.938 |
| CYP2C9-inhibitor: | 0.495 | CYP2C9-substrate: | 0.25 |
| CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.318 |
| CYP3A4-inhibitor: | 0.884 | CYP3A4-substrate: | 0.917 |
| Clearance (CL): | 1.714 | Half-life (T1/2): | 0.313 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.044 |
| Drug-inuced Liver Injury (DILI): | 0.416 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.828 | Maximum Recommended Daily Dose: | 0.746 |
| Skin Sensitization: | 0.939 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.021 | Eye Irritation: | 0.41 |
| Respiratory Toxicity: | 0.652 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004906 | ![]() |
1.000 | D0G8OC | ![]() |
0.435 | ||
| ENC002665 | ![]() |
0.737 | D06JPB | ![]() |
0.435 | ||
| ENC005707 | ![]() |
0.587 | D0G5CF | ![]() |
0.415 | ||
| ENC001092 | ![]() |
0.587 | D0G8BV | ![]() |
0.330 | ||
| ENC004738 | ![]() |
0.587 | D0F1UL | ![]() |
0.330 | ||
| ENC005258 | ![]() |
0.587 | D07BSQ | ![]() |
0.319 | ||
| ENC004905 | ![]() |
0.579 | D0N1TP | ![]() |
0.315 | ||
| ENC001861 | ![]() |
0.557 | D06XMU | ![]() |
0.309 | ||
| ENC004737 | ![]() |
0.557 | D04GJN | ![]() |
0.308 | ||
| ENC004022 | ![]() |
0.557 | D0W5LS | ![]() |
0.295 | ||