|
Name |
sphaeropsidin C
|
| Molecular Formula | C20H28O4 | |
| IUPAC Name* |
(4aR,4bR,7R,10aS)-7-ethenyl-4b-hydroxy-1,1,7-trimethyl-9-oxo-3,4,5,6,10,10a-hexahydro-2H-phenanthrene-4a-carboxylic acid
|
|
| SMILES |
C[C@@]1(CC[C@]2(C(=C1)C(=O)C[C@@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)C=C
|
|
| InChI |
InChI=1S/C20H28O4/c1-5-18(4)9-10-20(24)13(12-18)14(21)11-15-17(2,3)7-6-8-19(15,20)16(22)23/h5,12,15,24H,1,6-11H2,2-4H3,(H,22,23)/t15-,18-,19-,20+/m0/s1
|
|
| InChIKey |
VIDNIVWPSMVGJV-MVJPYGJCSA-N
|
|
| Synonyms |
sphaeropsidin C; CHEBI:69495; MLS003373235; CHEMBL1934132; SMR002047992; Q27137834; (4aR,4bR,7R,10aS)-7-ethenyl-4b-hydroxy-1,1,7-trimethyl-9-oxo-3,4,5,6,10,10a-hexahydro-2H-phenanthrene-4a-carboxylic acid
|
|
| CAS | NA | |
| PubChem CID | 10544575 | |
| ChEMBL ID | CHEMBL1934132 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 332.4 | ALogp: | 3.7 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 74.6 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.742 |
| Caco-2 Permeability: | -5.156 | MDCK Permeability: | 0.00001960 |
| Pgp-inhibitor: | 0.03 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.006 |
| Blood-Brain-Barrier Penetration (BBB): | 0.918 | Plasma Protein Binding (PPB): | 85.00% |
| Volume Distribution (VD): | 0.439 | Fu: | 15.21% |
| CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.555 |
| CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.638 |
| CYP2C9-inhibitor: | 0.157 | CYP2C9-substrate: | 0.499 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.105 |
| CYP3A4-inhibitor: | 0.347 | CYP3A4-substrate: | 0.414 |
| Clearance (CL): | 1.007 | Half-life (T1/2): | 0.502 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.632 |
| Drug-inuced Liver Injury (DILI): | 0.028 | AMES Toxicity: | 0.109 |
| Rat Oral Acute Toxicity: | 0.08 | Maximum Recommended Daily Dose: | 0.895 |
| Skin Sensitization: | 0.602 | Carcinogencity: | 0.599 |
| Eye Corrosion: | 0.734 | Eye Irritation: | 0.885 |
| Respiratory Toxicity: | 0.964 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002830 | ![]() |
0.600 | D04GJN | ![]() |
0.282 | ||
| ENC002731 | ![]() |
0.541 | D01CKY | ![]() |
0.279 | ||
| ENC002831 | ![]() |
0.530 | D0Q6NZ | ![]() |
0.275 | ||
| ENC002906 | ![]() |
0.433 | D0I2SD | ![]() |
0.269 | ||
| ENC001070 | ![]() |
0.417 | D0L2LS | ![]() |
0.265 | ||
| ENC001409 | ![]() |
0.415 | D0Z1XD | ![]() |
0.263 | ||
| ENC002923 | ![]() |
0.388 | D0R7JT | ![]() |
0.257 | ||
| ENC002083 | ![]() |
0.380 | D06AEO | ![]() |
0.250 | ||
| ENC002266 | ![]() |
0.375 | D0KR5B | ![]() |
0.250 | ||
| ENC002833 | ![]() |
0.374 | D0IX6I | ![]() |
0.250 | ||