![]() |
Name |
Sphaeropsidin D
|
Molecular Formula | C20H26O6 | |
IUPAC Name* |
(1R,2R,3R,5R,9S,10S)-5-ethenyl-2,3,9-trihydroxy-5,11,11-trimethyl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadec-6-ene-8,15-dione
|
|
SMILES |
C[C@@]1(C[C@H]([C@]2(C(=C1)C(=O)[C@@]3([C@@H]4[C@@]2(CCCC4(C)C)C(=O)O3)O)O)O)C=C
|
|
InChI |
InChI=1S/C20H26O6/c1-5-17(4)9-11-13(22)20(25)14-16(2,3)7-6-8-18(14,15(23)26-20)19(11,24)12(21)10-17/h5,9,12,14,21,24-25H,1,6-8,10H2,2-4H3/t12-,14+,17-,18+,19+,20-/m1/s1
|
|
InChIKey |
RGMZNUAVQHIGNL-WSFBEDDRSA-N
|
|
Synonyms |
Sphaeropsidin D; CHEBI:69496; CHEMBL1834676; Q27137835; (1R,2R,3R,5R,9S,10S)-5-ethenyl-2,3,9-trihydroxy-5,11,11-trimethyl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadec-6-ene-8,15-dione
|
|
CAS | NA | |
PubChem CID | 636779 | |
ChEMBL ID | CHEMBL1834676 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 362.4 | ALogp: | 1.7 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.485 |
Caco-2 Permeability: | -4.993 | MDCK Permeability: | 0.00002930 |
Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.101 | 20% Bioavailability (F20%): | 0.238 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.92 | Plasma Protein Binding (PPB): | 76.13% |
Volume Distribution (VD): | 1.123 | Fu: | 28.54% |
CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.833 |
CYP2C19-inhibitor: | 0.062 | CYP2C19-substrate: | 0.742 |
CYP2C9-inhibitor: | 0.104 | CYP2C9-substrate: | 0.056 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.072 |
CYP3A4-inhibitor: | 0.785 | CYP3A4-substrate: | 0.528 |
Clearance (CL): | 2.089 | Half-life (T1/2): | 0.296 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.256 |
Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.89 |
Rat Oral Acute Toxicity: | 0.961 | Maximum Recommended Daily Dose: | 0.911 |
Skin Sensitization: | 0.338 | Carcinogencity: | 0.677 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.141 |
Respiratory Toxicity: | 0.932 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002731 | ![]() |
0.722 | D0L2LS | ![]() |
0.276 | ||
ENC002832 | ![]() |
0.462 | D0G6AB | ![]() |
0.260 | ||
ENC002830 | ![]() |
0.415 | D0R7JT | ![]() |
0.257 | ||
ENC002041 | ![]() |
0.415 | D0P0HT | ![]() |
0.248 | ||
ENC002831 | ![]() |
0.404 | D0C8HR | ![]() |
0.244 | ||
ENC002829 | ![]() |
0.404 | D0H2MO | ![]() |
0.242 | ||
ENC002906 | ![]() |
0.396 | D0IT2G | ![]() |
0.241 | ||
ENC002083 | ![]() |
0.347 | D0CW1P | ![]() |
0.241 | ||
ENC002833 | ![]() |
0.340 | D07DVK | ![]() |
0.241 | ||
ENC002834 | ![]() |
0.333 | D0KR5B | ![]() |
0.239 |