![]() |
Name |
Phaeochromycin B
|
Molecular Formula | C18H18O6 | |
IUPAC Name* |
6-(4,7-dihydroxy-5-oxo-2-propyl-7,8-dihydro-6H-naphthalen-1-yl)-4-hydroxypyran-2-one
|
|
SMILES |
CCCC1=CC(=C2C(=C1C3=CC(=CC(=O)O3)O)CC(CC2=O)O)O
|
|
InChI |
InChI=1S/C18H18O6/c1-2-3-9-4-13(21)18-12(5-10(19)6-14(18)22)17(9)15-7-11(20)8-16(23)24-15/h4,7-8,10,19-21H,2-3,5-6H2,1H3
|
|
InChIKey |
IJTJWRLJKDGQIG-UHFFFAOYSA-N
|
|
Synonyms |
Phaeochromycin B
|
|
CAS | NA | |
PubChem CID | 54717038 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 330.3 | ALogp: | 2.4 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.798 |
Caco-2 Permeability: | -4.908 | MDCK Permeability: | 0.00000862 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.64 | 20% Bioavailability (F20%): | 0.995 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.029 | Plasma Protein Binding (PPB): | 95.22% |
Volume Distribution (VD): | 0.738 | Fu: | 5.18% |
CYP1A2-inhibitor: | 0.819 | CYP1A2-substrate: | 0.56 |
CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.232 | CYP2C9-substrate: | 0.761 |
CYP2D6-inhibitor: | 0.112 | CYP2D6-substrate: | 0.212 |
CYP3A4-inhibitor: | 0.089 | CYP3A4-substrate: | 0.116 |
Clearance (CL): | 4.657 | Half-life (T1/2): | 0.347 |
hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.116 |
Drug-inuced Liver Injury (DILI): | 0.714 | AMES Toxicity: | 0.051 |
Rat Oral Acute Toxicity: | 0.221 | Maximum Recommended Daily Dose: | 0.778 |
Skin Sensitization: | 0.169 | Carcinogencity: | 0.171 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.048 |
Respiratory Toxicity: | 0.877 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001509 | ![]() |
0.444 | D07MGA | ![]() |
0.351 | ||
ENC005180 | ![]() |
0.432 | D04AIT | ![]() |
0.292 | ||
ENC000974 | ![]() |
0.385 | D06FVX | ![]() |
0.275 | ||
ENC005644 | ![]() |
0.385 | D0K8KX | ![]() |
0.273 | ||
ENC001763 | ![]() |
0.375 | D03DJL | ![]() |
0.254 | ||
ENC002812 | ![]() |
0.365 | D02PMO | ![]() |
0.246 | ||
ENC002840 | ![]() |
0.357 | D0Z4XW | ![]() |
0.244 | ||
ENC006044 | ![]() |
0.357 | D0AZ8C | ![]() |
0.242 | ||
ENC000700 | ![]() |
0.351 | D06GCK | ![]() |
0.239 | ||
ENC005096 | ![]() |
0.351 | D0O1UZ | ![]() |
0.229 |