|
Name |
5-hydroxyscytalone
|
| Molecular Formula | C10H10O5 | |
| IUPAC Name* |
3,5,6,8-tetrahydroxy-3,4-dihydro-2H-naphthalen-1-one
|
|
| SMILES |
O=C1CC(O)Cc2c(O)c(O)cc(O)c21
|
|
| InChI |
InChI=1S/C10H10O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h3-4,11,13-15H,1-2H2/t4-/m1/s1
|
|
| InChIKey |
QKTWKMBSWRQQRQ-SCSAIBSYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 210.19 | ALogp: | 0.3 |
| HBD: | 4 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 98.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.373 |
| Caco-2 Permeability: | -5.282 | MDCK Permeability: | 0.00000466 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.059 |
| Human Intestinal Absorption (HIA): | 0.458 | 20% Bioavailability (F20%): | 0.95 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.422 | Plasma Protein Binding (PPB): | 49.12% |
| Volume Distribution (VD): | 1.108 | Fu: | 55.94% |
| CYP1A2-inhibitor: | 0.148 | CYP1A2-substrate: | 0.093 |
| CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.062 |
| CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.756 |
| CYP2D6-inhibitor: | 0.029 | CYP2D6-substrate: | 0.232 |
| CYP3A4-inhibitor: | 0.035 | CYP3A4-substrate: | 0.094 |
| Clearance (CL): | 12.293 | Half-life (T1/2): | 0.691 |
| hERG Blockers: | 0.051 | Human Hepatotoxicity (H-HT): | 0.052 |
| Drug-inuced Liver Injury (DILI): | 0.547 | AMES Toxicity: | 0.408 |
| Rat Oral Acute Toxicity: | 0.202 | Maximum Recommended Daily Dose: | 0.121 |
| Skin Sensitization: | 0.517 | Carcinogencity: | 0.033 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.399 |
| Respiratory Toxicity: | 0.389 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001509 | ![]() |
0.560 | D07MGA | ![]() |
0.329 | ||
| ENC005096 | ![]() |
0.500 | D0R6BI | ![]() |
0.269 | ||
| ENC004789 | ![]() |
0.481 | D0K8KX | ![]() |
0.250 | ||
| ENC002819 | ![]() |
0.432 | D04AIT | ![]() |
0.241 | ||
| ENC005853 | ![]() |
0.429 | D0H6QU | ![]() |
0.228 | ||
| ENC002936 | ![]() |
0.429 | D08LTU | ![]() |
0.221 | ||
| ENC003216 | ![]() |
0.429 | D0I3RO | ![]() |
0.215 | ||
| ENC006107 | ![]() |
0.429 | D0YH0N | ![]() |
0.215 | ||
| ENC003584 | ![]() |
0.414 | D0V9EN | ![]() |
0.210 | ||
| ENC002045 | ![]() |
0.404 | D07EXH | ![]() |
0.208 | ||