![]() |
Name |
d-Glycero-l-gluco-heptose
|
Molecular Formula | C7H14O7 | |
IUPAC Name* |
(2S,3R,4S,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanal
|
|
SMILES |
C([C@H]([C@@H]([C@@H]([C@H]([C@@H](C=O)O)O)O)O)O)O
|
|
InChI |
InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4-,5+,6+,7-/m1/s1
|
|
InChIKey |
YPZMPEPLWKRVLD-ULQPCXBYSA-N
|
|
Synonyms |
d-Glycero-l-gluco-heptose; 23102-92-3; BETA-D-GALACTOHEPTOSE; (2S,3R,4S,5S,6R)-2,3,4,5,6,7-HEXAHYDROXYHEPTANAL; beta-D-Mannoheptose; D-Galactoheptose; SCHEMBL2342352; DTXSID20610968; ZINC13522684; J-200007; W-201971
|
|
CAS | 23102-92-3 | |
PubChem CID | 21139463 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 210.18 | ALogp: | -3.6 |
HBD: | 6 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 138.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.241 |
Caco-2 Permeability: | -5.385 | MDCK Permeability: | 0.00136296 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.298 |
Human Intestinal Absorption (HIA): | 0.263 | 20% Bioavailability (F20%): | 0.853 |
30% Bioavailability (F30%): | 0.952 |
Blood-Brain-Barrier Penetration (BBB): | 0.567 | Plasma Protein Binding (PPB): | 13.84% |
Volume Distribution (VD): | 0.618 | Fu: | 72.99% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.021 |
CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.051 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.075 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.091 |
CYP3A4-inhibitor: | 0.002 | CYP3A4-substrate: | 0.006 |
Clearance (CL): | 1.317 | Half-life (T1/2): | 0.818 |
hERG Blockers: | 0.077 | Human Hepatotoxicity (H-HT): | 0.17 |
Drug-inuced Liver Injury (DILI): | 0.866 | AMES Toxicity: | 0.051 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.078 | Carcinogencity: | 0.002 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003038 | ![]() |
1.000 | D02KFP | ![]() |
0.557 | ||
ENC001002 | ![]() |
0.875 | D09MXS | ![]() |
0.548 | ||
ENC001267 | ![]() |
0.596 | D0P7EK | ![]() |
0.548 | ||
ENC000405 | ![]() |
0.548 | D0VM8K | ![]() |
0.500 | ||
ENC001758 | ![]() |
0.522 | D0T6VD | ![]() |
0.462 | ||
ENC000161 | ![]() |
0.429 | D06HZY | ![]() |
0.413 | ||
ENC005982 | ![]() |
0.397 | D0B8SY | ![]() |
0.341 | ||
ENC005983 | ![]() |
0.397 | D03MGL | ![]() |
0.240 | ||
ENC005901 | ![]() |
0.338 | D04QST | ![]() |
0.200 | ||
ENC001210 | ![]() |
0.314 | D04XDT | ![]() |
0.194 |