![]() |
Name |
1-Nitro-1-deoxy-d-glycero-l-mannoheptitol
|
Molecular Formula | C7H15NO8 | |
IUPAC Name* |
7-nitroheptane-1,2,3,4,5,6-hexol
|
|
SMILES |
C(C(C(C(C(C(CO)O)O)O)O)O)[N+](=O)[O-]
|
|
InChI |
InChI=1S/C7H15NO8/c9-2-4(11)6(13)7(14)5(12)3(10)1-8(15)16/h3-7,9-14H,1-2H2
|
|
InChIKey |
PCNAHKWQSJSICA-UHFFFAOYSA-N
|
|
Synonyms |
1-Nitro-1-deoxy-d-glycero-l-mannoheptitol; 1-Deoxy-1-nitroheptitol #
|
|
CAS | NA | |
PubChem CID | 552036 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 241.2 | ALogp: | -3.7 |
HBD: | 6 | HBA: | 8 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 167.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.192 |
Caco-2 Permeability: | -5.343 | MDCK Permeability: | 0.00183675 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.38 |
Human Intestinal Absorption (HIA): | 0.936 | 20% Bioavailability (F20%): | 0.054 |
30% Bioavailability (F30%): | 0.993 |
Blood-Brain-Barrier Penetration (BBB): | 0.715 | Plasma Protein Binding (PPB): | 12.11% |
Volume Distribution (VD): | 0.451 | Fu: | 70.15% |
CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.017 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.203 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.158 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.003 |
Clearance (CL): | 1.489 | Half-life (T1/2): | 0.688 |
hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.432 |
Drug-inuced Liver Injury (DILI): | 0.033 | AMES Toxicity: | 0.083 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.007 |
Skin Sensitization: | 0.038 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.046 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003038 | ![]() |
0.596 | D0P7EK | ![]() |
0.591 | ||
ENC002398 | ![]() |
0.596 | D09MXS | ![]() |
0.591 | ||
ENC000405 | ![]() |
0.591 | D0T6VD | ![]() |
0.500 | ||
ENC000136 | ![]() |
0.591 | D0VM8K | ![]() |
0.480 | ||
ENC001002 | ![]() |
0.538 | D02KFP | ![]() |
0.408 | ||
ENC001758 | ![]() |
0.500 | D06HZY | ![]() |
0.400 | ||
ENC000161 | ![]() |
0.444 | D0B8SY | ![]() |
0.386 | ||
ENC005901 | ![]() |
0.370 | D03MGL | ![]() |
0.265 | ||
ENC001210 | ![]() |
0.347 | D04QST | ![]() |
0.215 | ||
ENC005983 | ![]() |
0.344 | D04XDT | ![]() |
0.214 |