![]() |
Name |
Galactitol
|
Molecular Formula | C6H14O6 | |
IUPAC Name* |
(2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol
|
|
SMILES |
C([C@H]([C@@H]([C@@H]([C@H](CO)O)O)O)O)O
|
|
InChI |
InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-
|
|
InChIKey |
FBPFZTCFMRRESA-GUCUJZIJSA-N
|
|
Synonyms |
dulcitol; galactitol; 608-66-2; dulcite; D-Galactitol; Euonymit; dulcose; Melampyrin; Melampyrit; D-Dulcitol; (2R,3S,4R,5S)-Hexane-1,2,3,4,5,6-hexaol; (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol; Melampyrite; Melampyrum; meso-galactitol; L-galactitol; CHEBI:16813; NSC 1944; 113ZQ1Y7DD; DSSTox_CID_26051; DSSTox_RID_81307; DSSTox_GSID_46051; MFCD00064288; CAS-608-66-2; WURCS=2.0/1,1,0/[h2112h]/1/; UNII-113ZQ1Y7DD; galacto-Hexitol; NSC-1944; Dulcitol, puriss.; NCGC00159410-03; NCGC00159410-04; EINECS 210-165-2; Ambap5938; Dulcitol, >=99%; GALACTITOL [MI]; AI3-19423; Epitope ID:114704; GALACTITOL [USP-RS]; SCHEMBL25162; CHEMBL1773904; DTXSID1046051; HY-Y0418; Tox21_111643; Tox21_111644; s3864; ZINC18006959; AKOS008145350; Tox21_111643_1; Tox21_111644_1; CCG-266441; DS-6321; NCGC00164353-05; NCGC00166072-02; AC-34851; Dulcitol, Vetec(TM) reagent grade, 98%; CS-0015135; CS-0356545; G0005; EN300-66855; C01697; Q420367; LACTITOL MONOHYDRATE IMPURITY D [EP IMPURITY]; rel-(2R,3S,4R,5S)-Hexane-1,2,3,4,5,6-hexaol; Z1065647778; 118FFB2B-9CDF-4CF4-9706-6865B46BA004; Galactitol, European Pharmacopoeia (EP) Reference Standard; Galactitol, United States Pharmacopeia (USP) Reference Standard; Galactitol, Pharmaceutical Secondary Standard; Certified Reference Material; 2234851-14-8
|
|
CAS | 608-66-2 | |
PubChem CID | 11850 | |
ChEMBL ID | CHEMBL1773904 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 182.17 | ALogp: | -3.1 |
HBD: | 6 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 121.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.264 |
Caco-2 Permeability: | -5.302 | MDCK Permeability: | 0.00124415 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.45 |
Human Intestinal Absorption (HIA): | 0.776 | 20% Bioavailability (F20%): | 0.265 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.267 | Plasma Protein Binding (PPB): | 12.30% |
Volume Distribution (VD): | 0.362 | Fu: | 79.28% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.027 |
CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.101 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.105 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.009 |
Clearance (CL): | 1.49 | Half-life (T1/2): | 0.81 |
hERG Blockers: | 0.112 | Human Hepatotoxicity (H-HT): | 0.043 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.052 |
Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.001 |
Skin Sensitization: | 0.097 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.532 |
Respiratory Toxicity: | 0.017 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000136 | ![]() |
1.000 | D09MXS | ![]() |
1.000 | ||
ENC000161 | ![]() |
0.774 | D0P7EK | ![]() |
1.000 | ||
ENC001758 | ![]() |
0.625 | D0T6VD | ![]() |
0.578 | ||
ENC001267 | ![]() |
0.591 | D0VM8K | ![]() |
0.524 | ||
ENC003038 | ![]() |
0.548 | D06HZY | ![]() |
0.500 | ||
ENC002398 | ![]() |
0.548 | D02KFP | ![]() |
0.475 | ||
ENC001002 | ![]() |
0.489 | D0B8SY | ![]() |
0.400 | ||
ENC005982 | ![]() |
0.407 | D03MGL | ![]() |
0.280 | ||
ENC005983 | ![]() |
0.407 | D04QST | ![]() |
0.226 | ||
ENC005901 | ![]() |
0.406 | D04XDT | ![]() |
0.222 |