|
Name |
Dihydroaspyrone
|
| Molecular Formula | C9H14O4 | |
| IUPAC Name* |
(2R,3S)-3-hydroxy-5-[(2S)-2-hydroxypropyl]-2-methyl-2,3-dihydropyran-6-one
|
|
| SMILES |
C[C@@H]1[C@H](C=C(C(=O)O1)C[C@H](C)O)O
|
|
| InChI |
InChI=1S/C9H14O4/c1-5(10)3-7-4-8(11)6(2)13-9(7)12/h4-6,8,10-11H,3H2,1-2H3/t5-,6+,8-/m0/s1
|
|
| InChIKey |
QURYMMSJKKNQFX-BBVRLYRLSA-N
|
|
| Synonyms |
dihydroaspyrone; Dihydroaspirone; MLS000876746; CHEMBL399445; MEGxm0_000268; ACon1_001461; HMS2271J11; ZINC13660139; NCGC00180482-01; SMR000440586; BRD-K11385592-001-01-9; (2R,3S)-3-Hydroxy-5-[(2S)-2-hydroxypropyl]-2-methyl-2,3-dihydropyran-6-one
|
|
| CAS | NA | |
| PubChem CID | 16196967 | |
| ChEMBL ID | CHEMBL399445 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 186.2 | ALogp: | 0.0 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 13 | QED Weighted: | 0.612 |
| Caco-2 Permeability: | -4.498 | MDCK Permeability: | 0.00011637 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.014 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.125 |
| Blood-Brain-Barrier Penetration (BBB): | 0.42 | Plasma Protein Binding (PPB): | 22.25% |
| Volume Distribution (VD): | 1.048 | Fu: | 83.57% |
| CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.248 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.625 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.244 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.341 |
| CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.265 |
| Clearance (CL): | 7.59 | Half-life (T1/2): | 0.843 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.2 |
| Drug-inuced Liver Injury (DILI): | 0.317 | AMES Toxicity: | 0.038 |
| Rat Oral Acute Toxicity: | 0.042 | Maximum Recommended Daily Dose: | 0.357 |
| Skin Sensitization: | 0.346 | Carcinogencity: | 0.29 |
| Eye Corrosion: | 0.956 | Eye Irritation: | 0.892 |
| Respiratory Toxicity: | 0.058 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002575 | ![]() |
0.581 | D07AHW | ![]() |
0.250 | ||
| ENC005106 | ![]() |
0.511 | D0R2KF | ![]() |
0.232 | ||
| ENC003515 | ![]() |
0.447 | D03KXY | ![]() |
0.215 | ||
| ENC001016 | ![]() |
0.381 | D0V5IW | ![]() |
0.214 | ||
| ENC002813 | ![]() |
0.333 | D01GYT | ![]() |
0.205 | ||
| ENC005567 | ![]() |
0.321 | D0CL9S | ![]() |
0.194 | ||
| ENC005568 | ![]() |
0.321 | D06WTZ | ![]() |
0.188 | ||
| ENC003225 | ![]() |
0.321 | D00HCQ | ![]() |
0.186 | ||
| ENC004880 | ![]() |
0.321 | D0X5XU | ![]() |
0.182 | ||
| ENC004881 | ![]() |
0.321 | D0X7JN | ![]() |
0.180 | ||