![]() |
Name |
aspilactonol I
|
Molecular Formula | C9H14O4 | |
IUPAC Name* |
4-(2,3-dihydroxybutyl)-2-methyl-2H-furan-5-one
|
|
SMILES |
CC1C=C(CC(O)C(C)O)C(=O)O1
|
|
InChI |
InChI=1S/C9H14O4/c1-5-3-7(9(12)13-5)4-8(11)6(2)10/h3,5-6,8,10-11H,4H2,1-2H3/t5-,6+,8-/m1/s1
|
|
InChIKey |
ABBRWUBWDNUIEE-GKROBHDKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.21 | ALogp: | 0.0 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.626 |
Caco-2 Permeability: | -4.907 | MDCK Permeability: | 0.00056356 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.037 |
Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.712 |
Blood-Brain-Barrier Penetration (BBB): | 0.205 | Plasma Protein Binding (PPB): | 71.40% |
Volume Distribution (VD): | 2.528 | Fu: | 39.32% |
CYP1A2-inhibitor: | 0.048 | CYP1A2-substrate: | 0.38 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.256 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.792 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.535 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.131 |
Clearance (CL): | 13.518 | Half-life (T1/2): | 0.834 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.154 |
Drug-inuced Liver Injury (DILI): | 0.335 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.122 | Maximum Recommended Daily Dose: | 0.016 |
Skin Sensitization: | 0.075 | Carcinogencity: | 0.227 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.036 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002575 | ![]() |
0.545 | D07AHW | ![]() |
0.250 | ||
ENC001016 | ![]() |
0.526 | D0Q9YT | ![]() |
0.212 | ||
ENC002367 | ![]() |
0.511 | D0S2IQ | ![]() |
0.206 | ||
ENC005105 | ![]() |
0.435 | D00NPP | ![]() |
0.205 | ||
ENC002190 | ![]() |
0.356 | D0R2KF | ![]() |
0.197 | ||
ENC000874 | ![]() |
0.342 | D0R1QE | ![]() |
0.194 | ||
ENC005353 | ![]() |
0.310 | D0I8FI | ![]() |
0.194 | ||
ENC003800 | ![]() |
0.306 | D02UFG | ![]() |
0.194 | ||
ENC005201 | ![]() |
0.305 | D0V5IW | ![]() |
0.193 | ||
ENC005858 | ![]() |
0.305 | D0Z1WA | ![]() |
0.182 |