![]() |
Name |
(2R,3S)-3-hydroxy-2-methyl-5-[(2S,3S)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one
|
Molecular Formula | C9H12O4 | |
IUPAC Name* |
(2R,3S)-3-hydroxy-2-methyl-5-[(2R,3S)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one
|
|
SMILES |
C[C@@H]1[C@H](C=C(C(=O)O1)[C@@H]2[C@@H](O2)C)O
|
|
InChI |
InChI=1S/C9H12O4/c1-4-7(10)3-6(9(11)13-4)8-5(2)12-8/h3-5,7-8,10H,1-2H3/t4-,5+,7+,8+/m1/s1
|
|
InChIKey |
RCAULRNMJFUWRP-ZILMGAKASA-N
|
|
Synonyms |
Aspyrone; (2R,3S)-3-hydroxy-2-methyl-5-[(2S,3S)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one; 17398-00-4; (5S,6R)-5-Hydroxy-6-methyl-3-((2S,3S)-3-methyl-oxiran-2-yl)-5,6-dihydro-2H-pyran-2-one
|
|
CAS | NA | |
PubChem CID | 135921651 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 184.19 | ALogp: | -0.1 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 59.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 13 | QED Weighted: | 0.473 |
Caco-2 Permeability: | -4.55 | MDCK Permeability: | 0.00004280 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.078 |
Blood-Brain-Barrier Penetration (BBB): | 0.952 | Plasma Protein Binding (PPB): | 21.39% |
Volume Distribution (VD): | 0.926 | Fu: | 84.34% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.6 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.776 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.086 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.384 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.272 |
Clearance (CL): | 13.249 | Half-life (T1/2): | 0.779 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.183 |
Drug-inuced Liver Injury (DILI): | 0.813 | AMES Toxicity: | 0.123 |
Rat Oral Acute Toxicity: | 0.233 | Maximum Recommended Daily Dose: | 0.029 |
Skin Sensitization: | 0.333 | Carcinogencity: | 0.771 |
Eye Corrosion: | 0.876 | Eye Irritation: | 0.743 |
Respiratory Toxicity: | 0.16 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002367 | ![]() |
0.447 | D03KXY | ![]() |
0.254 | ||
ENC002880 | ![]() |
0.348 | D01GYT | ![]() |
0.205 | ||
ENC003147 | ![]() |
0.333 | D0K7LU | ![]() |
0.203 | ||
ENC002508 | ![]() |
0.316 | D0A2AJ | ![]() |
0.200 | ||
ENC004741 | ![]() |
0.304 | D00HCQ | ![]() |
0.200 | ||
ENC003225 | ![]() |
0.298 | D0R2KF | ![]() |
0.197 | ||
ENC005567 | ![]() |
0.298 | D0CL9S | ![]() |
0.194 | ||
ENC004880 | ![]() |
0.298 | D09FAZ | ![]() |
0.194 | ||
ENC004882 | ![]() |
0.298 | D0S7DV | ![]() |
0.194 | ||
ENC004881 | ![]() |
0.298 | D07XSN | ![]() |
0.194 |