|
Name |
Shearinine F
|
| Molecular Formula | C37H45NO5 | |
| IUPAC Name* |
(1S,4R,5S,23S,26S,30R)-26-hydroxy-4,5,13,13,15,15,31,31-octamethyl-14,32,33-trioxa-7-azanonacyclo[28.2.1.01,27.04,26.05,23.06,21.08,20.010,18.011,16]tritriaconta-6(21),8(20),9,11(16),18,27-hexaen-29-one
|
|
| SMILES |
C[C@]12CC[C@]34C(=CC(=O)[C@H](O3)C(O4)(C)C)[C@@]1(CC[C@@H]5[C@@]2(C6=C(C5)C7=C(N6)C=C8C(=C7)CC9=C8CC(OC9(C)C)(C)C)C)O
|
|
| InChI |
InChI=1S/C37H45NO5/c1-31(2)18-24-21-16-26-22(13-19(21)14-25(24)32(3,4)42-31)23-15-20-9-10-36(40)28-17-27(39)30-33(5,6)43-37(28,41-30)12-11-34(36,7)35(20,8)29(23)38-26/h13,16-17,20,30,38,40H,9-12,14-15,18H2,1-8H3/t20-,30-,34+,35+,36+,37-/m0/s1
|
|
| InChIKey |
QYRAHJVRFPJIQW-JDUCZRBWSA-N
|
|
| Synonyms |
SHEARININE F; Shearinine F_120146; DTXSID801046358; 925427-36-7
|
|
| CAS | 925427-36-7 | |
| PubChem CID | 16104607 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 583.8 | ALogp: | 3.9 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 80.8 | Aromatic Rings: | 9 |
| Heavy Atoms: | 43 | QED Weighted: | 0.368 |
| Caco-2 Permeability: | -5.041 | MDCK Permeability: | 0.00001810 |
| Pgp-inhibitor: | 0.738 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.934 |
| 30% Bioavailability (F30%): | 0.21 |
| Blood-Brain-Barrier Penetration (BBB): | 0.955 | Plasma Protein Binding (PPB): | 94.97% |
| Volume Distribution (VD): | 2.811 | Fu: | 5.28% |
| CYP1A2-inhibitor: | 0.04 | CYP1A2-substrate: | 0.986 |
| CYP2C19-inhibitor: | 0.494 | CYP2C19-substrate: | 0.852 |
| CYP2C9-inhibitor: | 0.67 | CYP2C9-substrate: | 0.049 |
| CYP2D6-inhibitor: | 0.166 | CYP2D6-substrate: | 0.196 |
| CYP3A4-inhibitor: | 0.908 | CYP3A4-substrate: | 0.945 |
| Clearance (CL): | 8.408 | Half-life (T1/2): | 0.038 |
| hERG Blockers: | 0.38 | Human Hepatotoxicity (H-HT): | 0.545 |
| Drug-inuced Liver Injury (DILI): | 0.437 | AMES Toxicity: | 0.056 |
| Rat Oral Acute Toxicity: | 0.968 | Maximum Recommended Daily Dose: | 0.969 |
| Skin Sensitization: | 0.67 | Carcinogencity: | 0.981 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.991 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003875 | ![]() |
0.818 | D0U3SY | ![]() |
0.227 | ||
| ENC001967 | ![]() |
0.597 | D06IIB | ![]() |
0.201 | ||
| ENC001923 | ![]() |
0.552 | D0Z1XD | ![]() |
0.200 | ||
| ENC005557 | ![]() |
0.434 | D0V6OA | ![]() |
0.199 | ||
| ENC002168 | ![]() |
0.373 | D08QKJ | ![]() |
0.199 | ||
| ENC003876 | ![]() |
0.366 | D04GJN | ![]() |
0.199 | ||
| ENC000836 | ![]() |
0.359 | D0L2LS | ![]() |
0.195 | ||
| ENC001492 | ![]() |
0.350 | D0Q4SD | ![]() |
0.194 | ||
| ENC003787 | ![]() |
0.349 | D0Q6NZ | ![]() |
0.194 | ||
| ENC002013 | ![]() |
0.329 | D01HTL | ![]() |
0.192 | ||