|
Name |
Terpendole A
|
| Molecular Formula | C32H41NO6 | |
| IUPAC Name* |
(1S,2R,13R,16R,17R,19S,20S,22R,25R,27R)-22-(3,3-dimethyloxiran-2-yl)-1,2,24,24-tetramethyl-18,21,23,26-tetraoxa-4-azaoctacyclo[14.13.0.02,13.03,11.05,10.017,19.017,27.020,25]nonacosa-3(11),5,7,9-tetraen-16-ol
|
|
| SMILES |
C[C@@]12CC[C@@H]3[C@]4([C@]1(CC[C@H]5[C@]2(C6=C(C5)C7=CC=CC=C7N6)C)O)[C@@H](O4)[C@@H]8[C@@H](O3)C(O[C@@H](O8)C9C(O9)(C)C)(C)C
|
|
| InChI |
InChI=1S/C32H41NO6/c1-27(2)23-21(36-26(39-27)25-28(3,4)37-25)24-32(38-24)20(35-23)12-13-29(5)30(6)16(11-14-31(29,32)34)15-18-17-9-7-8-10-19(17)33-22(18)30/h7-10,16,20-21,23-26,33-34H,11-15H2,1-6H3/t16-,20-,21+,23-,24+,25?,26-,29+,30+,31-,32-/m1/s1
|
|
| InChIKey |
XTBDVXSMPXFDAU-NYBSUTBHSA-N
|
|
| Synonyms |
Terpendole A
|
|
| CAS | NA | |
| PubChem CID | 139588327 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 535.7 | ALogp: | 3.8 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 88.8 | Aromatic Rings: | 9 |
| Heavy Atoms: | 39 | QED Weighted: | 0.499 |
| Caco-2 Permeability: | -5.138 | MDCK Permeability: | 0.00002860 |
| Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.037 |
| 30% Bioavailability (F30%): | 0.903 |
| Blood-Brain-Barrier Penetration (BBB): | 0.285 | Plasma Protein Binding (PPB): | 94.39% |
| Volume Distribution (VD): | 1.296 | Fu: | 3.90% |
| CYP1A2-inhibitor: | 0.027 | CYP1A2-substrate: | 0.833 |
| CYP2C19-inhibitor: | 0.229 | CYP2C19-substrate: | 0.671 |
| CYP2C9-inhibitor: | 0.528 | CYP2C9-substrate: | 0.036 |
| CYP2D6-inhibitor: | 0.094 | CYP2D6-substrate: | 0.689 |
| CYP3A4-inhibitor: | 0.645 | CYP3A4-substrate: | 0.632 |
| Clearance (CL): | 4.367 | Half-life (T1/2): | 0.171 |
| hERG Blockers: | 0.822 | Human Hepatotoxicity (H-HT): | 0.648 |
| Drug-inuced Liver Injury (DILI): | 0.08 | AMES Toxicity: | 0.034 |
| Rat Oral Acute Toxicity: | 0.766 | Maximum Recommended Daily Dose: | 0.953 |
| Skin Sensitization: | 0.383 | Carcinogencity: | 0.236 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.986 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002013 | ![]() |
0.785 | D0H4JM | ![]() |
0.252 | ||
| ENC003931 | ![]() |
0.760 | D01JGV | ![]() |
0.227 | ||
| ENC003930 | ![]() |
0.760 | D0U7GP | ![]() |
0.227 | ||
| ENC001966 | ![]() |
0.621 | D04RLY | ![]() |
0.218 | ||
| ENC003834 | ![]() |
0.543 | D0OT9S | ![]() |
0.213 | ||
| ENC005557 | ![]() |
0.478 | D0W9MM | ![]() |
0.212 | ||
| ENC003929 | ![]() |
0.473 | D01HTL | ![]() |
0.212 | ||
| ENC000857 | ![]() |
0.452 | D0KR9U | ![]() |
0.210 | ||
| ENC000836 | ![]() |
0.445 | D09QVV | ![]() |
0.210 | ||
| ENC004710 | ![]() |
0.445 | D0W2EK | ![]() |
0.208 | ||