|
Name |
Sespendole
|
| Molecular Formula | C33H45NO4 | |
| IUPAC Name* |
(1S,12S,15S,20R)-7-[(S)-(3,3-dimethyloxiran-2-yl)-hydroxymethyl]-15-hydroxy-1,16,16,20-tetramethyl-8-(3-methylbut-2-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4(9),5,7-tetraen-17-one
|
|
| SMILES |
CC(=CCC1=C(C=CC2=C1C3=C(N2)[C@]4([C@H](C3)CC[C@@]5([C@@]4(CCC(=O)C5(C)C)C)O)C)[C@@H](C6C(O6)(C)C)O)C
|
|
| InChI |
InChI=1S/C33H45NO4/c1-18(2)9-10-20-21(26(36)28-30(5,6)38-28)11-12-23-25(20)22-17-19-13-16-33(37)29(3,4)24(35)14-15-31(33,7)32(19,8)27(22)34-23/h9,11-12,19,26,28,34,36-37H,10,13-17H2,1-8H3/t19-,26-,28?,31+,32+,33+/m0/s1
|
|
| InChIKey |
QMEIUISJYPRNPF-ZWXFSXOLSA-N
|
|
| Synonyms |
Sespendole; SCHEMBL6898712; (1S,12S,15S,20R)-7-[(S)-(3,3-dimethyloxiran-2-yl)-hydroxymethyl]-15-hydroxy-1,16,16,20-tetramethyl-8-(3-methylbut-2-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4(9),5,7-tetraen-17-one
|
|
| CAS | NA | |
| PubChem CID | 11598840 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 519.7 | ALogp: | 5.4 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 85.8 | Aromatic Rings: | 6 |
| Heavy Atoms: | 38 | QED Weighted: | 0.329 |
| Caco-2 Permeability: | -4.939 | MDCK Permeability: | 0.00001370 |
| Pgp-inhibitor: | 0.739 | Pgp-substrate: | 0.95 |
| Human Intestinal Absorption (HIA): | 0.177 | 20% Bioavailability (F20%): | 0.975 |
| 30% Bioavailability (F30%): | 0.982 |
| Blood-Brain-Barrier Penetration (BBB): | 0.957 | Plasma Protein Binding (PPB): | 90.00% |
| Volume Distribution (VD): | 1.812 | Fu: | 7.46% |
| CYP1A2-inhibitor: | 0.084 | CYP1A2-substrate: | 0.904 |
| CYP2C19-inhibitor: | 0.511 | CYP2C19-substrate: | 0.878 |
| CYP2C9-inhibitor: | 0.655 | CYP2C9-substrate: | 0.794 |
| CYP2D6-inhibitor: | 0.286 | CYP2D6-substrate: | 0.595 |
| CYP3A4-inhibitor: | 0.707 | CYP3A4-substrate: | 0.886 |
| Clearance (CL): | 13.32 | Half-life (T1/2): | 0.101 |
| hERG Blockers: | 0.762 | Human Hepatotoxicity (H-HT): | 0.591 |
| Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.971 | Maximum Recommended Daily Dose: | 0.942 |
| Skin Sensitization: | 0.095 | Carcinogencity: | 0.962 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.983 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001923 | ![]() |
0.530 | D0W2EK | ![]() |
0.233 | ||
| ENC001967 | ![]() |
0.507 | D0H2MO | ![]() |
0.231 | ||
| ENC002013 | ![]() |
0.412 | D06YFA | ![]() |
0.228 | ||
| ENC003929 | ![]() |
0.397 | D04GJN | ![]() |
0.223 | ||
| ENC005557 | ![]() |
0.392 | D0W6DG | ![]() |
0.221 | ||
| ENC003329 | ![]() |
0.391 | D06IIB | ![]() |
0.216 | ||
| ENC003931 | ![]() |
0.383 | D02NSF | ![]() |
0.215 | ||
| ENC003930 | ![]() |
0.383 | D0Q0PR | ![]() |
0.214 | ||
| ENC003787 | ![]() |
0.379 | D0X3FX | ![]() |
0.214 | ||
| ENC003875 | ![]() |
0.377 | D03YVO | ![]() |
0.214 | ||