![]() |
Name |
delta-Elemene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(3R,4R)-4-ethenyl-4-methyl-1-propan-2-yl-3-prop-1-en-2-ylcyclohexene
|
|
SMILES |
CC(C)C1=C[C@@H]([C@@](CC1)(C)C=C)C(=C)C
|
|
InChI |
InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,10-11,14H,1,4,8-9H2,2-3,5-6H3/t14-,15+/m1/s1
|
|
InChIKey |
MXDMETWAEGIFOE-CABCVRRESA-N
|
|
Synonyms |
delta-Elemene; 11029-06-4; 20307-84-0; (1R,2R)-delta-elemene; CHEBI:132830; Q63409802; (R,R)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene; (3R,4R)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene; (3R,4R)-4-ethenyl-4-methyl-1-propan-2-yl-3-prop-1-en-2-ylcyclohexene; (3R,trans)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene; (3R-trans)-4-ethenyl-4-methyl-3-(1-methylethenyl)-1-(1-methylethyl)-cyclohexene
|
|
CAS | 20307-84-0 | |
PubChem CID | 12309449 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 5.3 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.556 |
Caco-2 Permeability: | -4.549 | MDCK Permeability: | 0.00001780 |
Pgp-inhibitor: | 0.962 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.842 |
30% Bioavailability (F30%): | 0.085 |
Blood-Brain-Barrier Penetration (BBB): | 0.041 | Plasma Protein Binding (PPB): | 93.66% |
Volume Distribution (VD): | 2.864 | Fu: | 5.79% |
CYP1A2-inhibitor: | 0.621 | CYP1A2-substrate: | 0.756 |
CYP2C19-inhibitor: | 0.456 | CYP2C19-substrate: | 0.928 |
CYP2C9-inhibitor: | 0.367 | CYP2C9-substrate: | 0.721 |
CYP2D6-inhibitor: | 0.422 | CYP2D6-substrate: | 0.869 |
CYP3A4-inhibitor: | 0.854 | CYP3A4-substrate: | 0.426 |
Clearance (CL): | 1.774 | Half-life (T1/2): | 0.196 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.153 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.044 |
Skin Sensitization: | 0.029 | Carcinogencity: | 0.097 |
Eye Corrosion: | 0.288 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.103 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000782 | ![]() |
1.000 | D01CKY | ![]() |
0.200 | ||
ENC001895 | ![]() |
0.345 | D0W6DG | ![]() |
0.183 | ||
ENC002272 | ![]() |
0.313 | D04GJN | ![]() |
0.176 | ||
ENC003551 | ![]() |
0.313 | D0O1UZ | ![]() |
0.172 | ||
ENC002988 | ![]() |
0.300 | D0H1QY | ![]() |
0.172 | ||
ENC001279 | ![]() |
0.274 | D0H6VY | ![]() |
0.172 | ||
ENC003255 | ![]() |
0.270 | D0S7WX | ![]() |
0.171 | ||
ENC002990 | ![]() |
0.270 | D0K5WS | ![]() |
0.170 | ||
ENC001815 | ![]() |
0.270 | D08KVZ | ![]() |
0.169 | ||
ENC000198 | ![]() |
0.269 | D00DKK | ![]() |
0.167 |