![]() |
Name |
cis-Eudesma-6,11-diene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(4R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene
|
|
SMILES |
C[C@@H]1CCC[C@@]2(C1C=C(CC2)C(=C)C)C
|
|
InChI |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h10,12,14H,1,5-9H2,2-4H3/t12-,14?,15+/m1/s1
|
|
InChIKey |
GZTVOICLUQHEMR-ATFAPYMMSA-N
|
|
Synonyms |
cis-Eudesma-6,11-diene
|
|
CAS | NA | |
PubChem CID | 6428368 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 5.5 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.554 |
Caco-2 Permeability: | -4.5 | MDCK Permeability: | 0.00000919 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.03 |
Blood-Brain-Barrier Penetration (BBB): | 0.178 | Plasma Protein Binding (PPB): | 93.16% |
Volume Distribution (VD): | 1.921 | Fu: | 7.07% |
CYP1A2-inhibitor: | 0.782 | CYP1A2-substrate: | 0.773 |
CYP2C19-inhibitor: | 0.521 | CYP2C19-substrate: | 0.897 |
CYP2C9-inhibitor: | 0.419 | CYP2C9-substrate: | 0.225 |
CYP2D6-inhibitor: | 0.43 | CYP2D6-substrate: | 0.382 |
CYP3A4-inhibitor: | 0.687 | CYP3A4-substrate: | 0.531 |
Clearance (CL): | 14.807 | Half-life (T1/2): | 0.24 |
hERG Blockers: | 0.084 | Human Hepatotoxicity (H-HT): | 0.617 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.111 | Maximum Recommended Daily Dose: | 0.609 |
Skin Sensitization: | 0.959 | Carcinogencity: | 0.309 |
Eye Corrosion: | 0.778 | Eye Irritation: | 0.868 |
Respiratory Toxicity: | 0.811 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002403 | ![]() |
0.447 | D0I2SD | ![]() |
0.239 | ||
ENC002138 | ![]() |
0.390 | D04GJN | ![]() |
0.239 | ||
ENC001079 | ![]() |
0.390 | D07BSQ | ![]() |
0.235 | ||
ENC001437 | ![]() |
0.367 | D0F1UL | ![]() |
0.235 | ||
ENC002073 | ![]() |
0.367 | D04SFH | ![]() |
0.225 | ||
ENC000332 | ![]() |
0.367 | D0V2JK | ![]() |
0.223 | ||
ENC001836 | ![]() |
0.367 | D0B4RU | ![]() |
0.221 | ||
ENC001829 | ![]() |
0.367 | D06AEO | ![]() |
0.217 | ||
ENC002990 | ![]() |
0.367 | D0SC8F | ![]() |
0.217 | ||
ENC003255 | ![]() |
0.344 | D07QKN | ![]() |
0.217 |