|
Name |
alpha-Terpinene
|
| Molecular Formula | C10H16 | |
| IUPAC Name* |
1-methyl-4-propan-2-ylcyclohexa-1,3-diene
|
|
| SMILES |
CC1=CC=C(CC1)C(C)C
|
|
| InChI |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3
|
|
| InChIKey |
YHQGMYUVUMAZJR-UHFFFAOYSA-N
|
|
| Synonyms |
ALPHA-TERPINENE; 99-86-5; Terpilene; p-Mentha-1,3-diene; 1,3-Cyclohexadiene, 1-methyl-4-(1-methylethyl)-; 1-Isopropyl-4-methyl-1,3-cyclohexadiene; alpha-Terpinen; 1-Methyl-4-(1-methylethyl)-1,3-cyclohexadiene; .alpha.-Terpinen; 1-methyl-4-propan-2-ylcyclohexa-1,3-diene; 1-isopropyl-4-methylcyclohexa-1,3-diene; FEMA No. 3558; a-terpinene; 1-methyl-4-(propan-2-yl)cyclohexa-1,3-diene; 1-Methyl-4-isopropylcyclohexadiene-1,3; alpha -Terpinene; .alpha.-Terpinene; CHEBI:10334; 1-isopropyl-4-methyl-cyclohexa-1,3-diene; 1,3-Cyclohexadiene, 1-methyl-4-isopropyl-; 1-Methyl-4-isopropyl-1,3-cyclohexadiene; I24X278AP1; CCRIS 9058; EINECS 202-795-1; alphaTerpinene; UNII-I24X278AP1; AI3-26467; .alpha.-Terpine; MFCD00001534; .ALPHA.TERPINENE; alpha-Terpinene, 85%; Epitope ID:123897; Alpha-Terpinene (~90%); DSSTox_CID_21237; DSSTox_RID_79657; DSSTox_GSID_41237; ALPHA-TERPINENE [FCC]; Alpha-terpinene alpha-terpinene; CHEMBL2251642; DTXSID9041237; FEMA 3558; ZINC967593; alpha-Terpinene, analytical standard; Tox21_301126; alpha-Terpinene, >=95.0% (GC); P-MENTHA-1,3-DIENE [FHFI]; AKOS015841730; alpha-Terpinene, >=89%, FCC, FG; HY-W020182; LMPR0102090026; CAS-99-86-5; NCGC00248299-01; NCGC00255025-01; BS-33443; CS-0039183; FT-0622940; M0317; C09898; E75753; 4-ISOPROPYL-1-METHYL-1,3-CYCLOHEXADIENE; A-Terpinene =89%, contains BHT as stabilizer; alpha-Terpinene 2000 microg/mL in Acetonitrile; EN300-6738504; Q423851; W-100014; 9MI
|
|
| CAS | 99-86-5 | |
| PubChem CID | 7462 | |
| ChEMBL ID | CHEMBL2251642 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 136.23 | ALogp: | 2.8 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 10 | QED Weighted: | 0.509 |
| Caco-2 Permeability: | -4.475 | MDCK Permeability: | 0.00002020 |
| Pgp-inhibitor: | 0.474 | Pgp-substrate: | 0.017 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.019 |
| 30% Bioavailability (F30%): | 0.103 |
| Blood-Brain-Barrier Penetration (BBB): | 0.451 | Plasma Protein Binding (PPB): | 93.25% |
| Volume Distribution (VD): | 2.857 | Fu: | 9.54% |
| CYP1A2-inhibitor: | 0.549 | CYP1A2-substrate: | 0.873 |
| CYP2C19-inhibitor: | 0.14 | CYP2C19-substrate: | 0.948 |
| CYP2C9-inhibitor: | 0.12 | CYP2C9-substrate: | 0.705 |
| CYP2D6-inhibitor: | 0.595 | CYP2D6-substrate: | 0.883 |
| CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.555 |
| Clearance (CL): | 0.877 | Half-life (T1/2): | 0.616 |
| hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.172 |
| Drug-inuced Liver Injury (DILI): | 0.114 | AMES Toxicity: | 0.02 |
| Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.141 |
| Skin Sensitization: | 0.815 | Carcinogencity: | 0.723 |
| Eye Corrosion: | 0.855 | Eye Irritation: | 0.987 |
| Respiratory Toxicity: | 0.159 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002218 | ![]() |
0.511 | D06GIP | ![]() |
0.273 | ||
| ENC000197 | ![]() |
0.459 | D0A3HB | ![]() |
0.220 | ||
| ENC000963 | ![]() |
0.459 | D06IXT | ![]() |
0.197 | ||
| ENC000165 | ![]() |
0.333 | D0X0RI | ![]() |
0.192 | ||
| ENC000395 | ![]() |
0.317 | D01PJR | ![]() |
0.185 | ||
| ENC001072 | ![]() |
0.308 | D08KVZ | ![]() |
0.182 | ||
| ENC000339 | ![]() |
0.308 | D0YQ5L | ![]() |
0.179 | ||
| ENC001817 | ![]() |
0.308 | D03QJL | ![]() |
0.177 | ||
| ENC000762 | ![]() |
0.302 | D0R1QE | ![]() |
0.175 | ||
| ENC001637 | ![]() |
0.302 | D0P4MT | ![]() |
0.171 | ||