|
Name |
(2S,3R,6S,8R,9R,12S,15S,20S,21S,23S)-21-(2-hydroxypropan-2-yl)-2,3,24,24-tetramethyl-8-prop-1-en-2-yl-7-oxa-29-azaoctacyclo[15.12.0.02,15.03,12.06,11.018,28.019,25.020,23]nonacosa-1(17),10,18(28),19(25),26-pentaene-9,12-diol
|
| Molecular Formula | C37H49NO4 | |
| IUPAC Name* |
(2S,3R,6S,8R,9R,12S,15S,20S,21S,23S)-21-(2-hydroxypropan-2-yl)-2,3,24,24-tetramethyl-8-prop-1-en-2-yl-7-oxa-29-azaoctacyclo[15.12.0.02,15.03,12.06,11.018,28.019,25.020,23]nonacosa-1(17),10,18(28),19(25),26-pentaene-9,12-diol
|
|
| SMILES |
CC(=C)[C@@H]1[C@@H](C=C2[C@@H](O1)CC[C@]3([C@]2(CC[C@@H]4[C@@]3(C5=C(C4)C6=C(N5)C=CC7=C6[C@H]8[C@@H](C7(C)C)C[C@@H]8C(C)(C)O)C)O)C)O
|
|
| InChI |
InChI=1S/C37H49NO4/c1-18(2)31-26(39)17-22-27(42-31)12-13-35(7)36(8)19(11-14-37(22,35)41)15-20-28-25(38-32(20)36)10-9-21-30(28)29-23(33(21,3)4)16-24(29)34(5,6)40/h9-10,17,19,23-24,26-27,29,31,38-41H,1,11-16H2,2-8H3/t19-,23-,24-,26+,27-,29-,31+,35+,36+,37+/m0/s1
|
|
| InChIKey |
XGLAABAXPYURRZ-WDMOMHLCSA-N
|
|
| Synonyms |
PC-M4
|
|
| CAS | NA | |
| PubChem CID | 122394030 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 571.8 | ALogp: | 5.4 |
| HBD: | 4 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 85.7 | Aromatic Rings: | 8 |
| Heavy Atoms: | 42 | QED Weighted: | 0.318 |
| Caco-2 Permeability: | -5.232 | MDCK Permeability: | 0.00001200 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.85 |
| Human Intestinal Absorption (HIA): | 0.048 | 20% Bioavailability (F20%): | 0.851 |
| 30% Bioavailability (F30%): | 0.303 |
| Blood-Brain-Barrier Penetration (BBB): | 0.793 | Plasma Protein Binding (PPB): | 89.19% |
| Volume Distribution (VD): | 2.253 | Fu: | 7.14% |
| CYP1A2-inhibitor: | 0.048 | CYP1A2-substrate: | 0.906 |
| CYP2C19-inhibitor: | 0.284 | CYP2C19-substrate: | 0.751 |
| CYP2C9-inhibitor: | 0.427 | CYP2C9-substrate: | 0.145 |
| CYP2D6-inhibitor: | 0.26 | CYP2D6-substrate: | 0.21 |
| CYP3A4-inhibitor: | 0.842 | CYP3A4-substrate: | 0.906 |
| Clearance (CL): | 6.817 | Half-life (T1/2): | 0.006 |
| hERG Blockers: | 0.906 | Human Hepatotoxicity (H-HT): | 0.227 |
| Drug-inuced Liver Injury (DILI): | 0.051 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.988 | Maximum Recommended Daily Dose: | 0.958 |
| Skin Sensitization: | 0.137 | Carcinogencity: | 0.944 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.991 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003330 | ![]() |
0.763 | D0W2EK | ![]() |
0.237 | ||
| ENC001486 | ![]() |
0.578 | D02IQY | ![]() |
0.225 | ||
| ENC003453 | ![]() |
0.529 | D06AEO | ![]() |
0.224 | ||
| ENC000836 | ![]() |
0.478 | D0X7XG | ![]() |
0.223 | ||
| ENC003832 | ![]() |
0.472 | D0P0HT | ![]() |
0.222 | ||
| ENC003833 | ![]() |
0.466 | D0H2JP | ![]() |
0.222 | ||
| ENC003660 | ![]() |
0.464 | D06AWE | ![]() |
0.222 | ||
| ENC001492 | ![]() |
0.452 | D04GJN | ![]() |
0.220 | ||
| ENC003929 | ![]() |
0.427 | D0I2SD | ![]() |
0.220 | ||
| ENC001966 | ![]() |
0.418 | D04SFH | ![]() |
0.220 | ||