| 
                    Name | 
                         Perinadine A 
                     | 
                
| Molecular Formula | C28H37NO7 | |
| IUPAC Name* | 
                         (6S,7R,9S,10S,14R)-3-hydroxy-4,6,7-trimethyl-13-[(E)-2-methyl-3-oxodec-8-enoyl]-8,15-dioxa-13-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),2,4-triene-2-carboxylic acid 
                     | 
                |
| SMILES | 
                         C/C=C/CCCCC(=O)C(C)C(=O)N1CC[C@@H]2[C@H]1OC3=C4[C@H]2O[C@@H]([C@H](C4=C(C(=C3C(=O)O)O)C)C)C 
                     | 
                |
| InChI | 
                         InChI=1S/C28H37NO7/c1-6-7-8-9-10-11-19(30)15(3)26(32)29-13-12-18-24-21-20(14(2)17(5)35-24)16(4)23(31)22(28(33)34)25(21)36-27(18)29/h6-7,14-15,17-18,24,27,31H,8-13H2,1-5H3,(H,33,34)/b7-6+/t14-,15?,17-,18+,24+,27-/m1/s1 
                     | 
                |
| InChIKey | 
                         SUQZYGYUFVUJGV-DIPCPZNJSA-N 
                     | 
                |
| Synonyms | 
                         Perinadine A; (6S,7R,9S,10S,14R)-3-Hydroxy-4,6,7-trimethyl-13-[(E)-2-methyl-3-oxodec-8-enoyl]-8,15-dioxa-13-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),2,4-triene-2-carboxylic acid 
                     | 
                |
| CAS | NA | |
| PubChem CID | 11598520 | |
| ChEMBL ID | NA | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 499.6 | ALogp: | 4.9 | 
| HBD: | 2 | HBA: | 7 | 
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 113.0 | Aromatic Rings: | 4 | 
| Heavy Atoms: | 36 | QED Weighted: | 0.285 | 
| Caco-2 Permeability: | -5.385 | MDCK Permeability: | 0.00002060 | 
| Pgp-inhibitor: | 0.472 | Pgp-substrate: | 0.388 | 
| Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.014 | 
| 30% Bioavailability (F30%): | 0.032 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.055 | Plasma Protein Binding (PPB): | 99.90% | 
| Volume Distribution (VD): | 0.527 | Fu: | 1.66% | 
| CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.122 | 
| CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.497 | 
| CYP2C9-inhibitor: | 0.226 | CYP2C9-substrate: | 0.863 | 
| CYP2D6-inhibitor: | 0.035 | CYP2D6-substrate: | 0.133 | 
| CYP3A4-inhibitor: | 0.382 | CYP3A4-substrate: | 0.157 | 
| Clearance (CL): | 1.393 | Half-life (T1/2): | 0.431 | 
| hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.734 | 
| Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.011 | 
| Rat Oral Acute Toxicity: | 0.8 | Maximum Recommended Daily Dose: | 0.275 | 
| Skin Sensitization: | 0.11 | Carcinogencity: | 0.356 | 
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 | 
| Respiratory Toxicity: | 0.06 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005202 | ![]()  | 
                    0.403 | D0O5FY | ![]()  | 
                    0.219 | ||
| ENC000945 | ![]()  | 
                    0.313 | D0WY9N | ![]()  | 
                    0.208 | ||
| ENC006017 | ![]()  | 
                    0.282 | D0H2YX | ![]()  | 
                    0.207 | ||
| ENC005296 | ![]()  | 
                    0.282 | D0Q1MS | ![]()  | 
                    0.205 | ||
| ENC002792 | ![]()  | 
                    0.263 | D03JSJ | ![]()  | 
                    0.205 | ||
| ENC006018 | ![]()  | 
                    0.263 | D07UWV | ![]()  | 
                    0.205 | ||
| ENC004086 | ![]()  | 
                    0.253 | D0U5CE | ![]()  | 
                    0.205 | ||
| ENC003668 | ![]()  | 
                    0.252 | D03LGG | ![]()  | 
                    0.205 | ||
| ENC006016 | ![]()  | 
                    0.248 | D07IPB | ![]()  | 
                    0.204 | ||
| ENC001023 | ![]()  | 
                    0.245 | D04FBR | ![]()  | 
                    0.201 | ||