![]() |
Name |
Nezukol
|
Molecular Formula | C20H34O | |
IUPAC Name* |
(4aS,4bR,7S,8aR,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-ol
|
|
SMILES |
C[C@@]1(CC[C@@H]2[C@]3(CCCC([C@@H]3CC[C@]2(C1)O)(C)C)C)C=C
|
|
InChI |
InChI=1S/C20H34O/c1-6-18(4)12-8-16-19(5)11-7-10-17(2,3)15(19)9-13-20(16,21)14-18/h6,15-16,21H,1,7-14H2,2-5H3/t15-,16+,18-,19-,20+/m0/s1
|
|
InChIKey |
IYDAPILQPCDHTO-HHUCQEJWSA-N
|
|
Synonyms |
nezukol; pimar-15-en-8-ol; 8beta-hydroxyisopimarene; isopimar-15-en-8-ol; 8beta-hydroxyisopimar-15-ene; (13alpha)-pimar-15-en-8-ol; CHEBI:138166; [13S,(?)]-Pimara-15-ene-8-ol; C21709; (4aS,4bR,7S,8aR,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-ol; 14699-32-2
|
|
CAS | 14699-32-2 | |
PubChem CID | 13969544 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.5 | ALogp: | 6.1 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.625 |
Caco-2 Permeability: | -4.698 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.231 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.85 |
30% Bioavailability (F30%): | 0.802 |
Blood-Brain-Barrier Penetration (BBB): | 0.137 | Plasma Protein Binding (PPB): | 93.91% |
Volume Distribution (VD): | 1.215 | Fu: | 5.95% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.567 |
CYP2C19-inhibitor: | 0.069 | CYP2C19-substrate: | 0.868 |
CYP2C9-inhibitor: | 0.171 | CYP2C9-substrate: | 0.342 |
CYP2D6-inhibitor: | 0.205 | CYP2D6-substrate: | 0.155 |
CYP3A4-inhibitor: | 0.904 | CYP3A4-substrate: | 0.356 |
Clearance (CL): | 7.342 | Half-life (T1/2): | 0.114 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.248 |
Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.167 | Maximum Recommended Daily Dose: | 0.577 |
Skin Sensitization: | 0.833 | Carcinogencity: | 0.161 |
Eye Corrosion: | 0.956 | Eye Irritation: | 0.632 |
Respiratory Toxicity: | 0.914 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002608 | ![]() |
0.575 | D0U3GL | ![]() |
0.283 | ||
ENC001070 | ![]() |
0.514 | D0Z1XD | ![]() |
0.283 | ||
ENC001452 | ![]() |
0.493 | D0Q6NZ | ![]() |
0.281 | ||
ENC003102 | ![]() |
0.487 | D08QKJ | ![]() |
0.263 | ||
ENC003145 | ![]() |
0.487 | D0L2LS | ![]() |
0.258 | ||
ENC002923 | ![]() |
0.486 | D0I2SD | ![]() |
0.250 | ||
ENC000946 | ![]() |
0.474 | D04GJN | ![]() |
0.238 | ||
ENC004411 | ![]() |
0.415 | D0B4RU | ![]() |
0.235 | ||
ENC000956 | ![]() |
0.408 | D00VZZ | ![]() |
0.235 | ||
ENC004227 | ![]() |
0.407 | D04DJN | ![]() |
0.234 |