![]() |
Name |
Arthrinone
|
Molecular Formula | C13H12O7 | |
IUPAC Name* |
(1R,9R,10S,13R)-4,9,13-trihydroxy-6-methoxy-12,14-dioxatetracyclo[8.3.1.01,10.03,8]tetradeca-3(8),4,6-trien-2-one
|
|
SMILES |
COC1=CC2=C(C(=C1)O)C(=O)[C@]34[C@@H](OC[C@@]3([C@@H]2O)O4)O
|
|
InChI |
InChI=1S/C13H12O7/c1-18-5-2-6-8(7(14)3-5)10(16)13-11(17)19-4-12(13,20-13)9(6)15/h2-3,9,11,14-15,17H,4H2,1H3/t9-,11-,12+,13+/m1/s1
|
|
InChIKey |
OACKXIAQYYDGIK-XEZLXBQYSA-N
|
|
Synonyms |
Arthrinone; CHEMBL2036280; DTXSID701119429; 162112-39-2; 1H,3H-3a,9a-Epoxynaphtho[2,3-c]furan-4(9H)-one, 3,5,9-trihydroxy-7-methoxy-, (3R,3aR,9R,9aS)-; 3beta,5,9beta-Trihydroxy-7-methoxy-3aalpha,9aalpha-epoxy-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-one
|
|
CAS | 162112-39-2 | |
PubChem CID | 10446362 | |
ChEMBL ID | CHEMBL2036280 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 280.23 | ALogp: | -0.7 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 109.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 20 | QED Weighted: | 0.618 |
Caco-2 Permeability: | -5.827 | MDCK Permeability: | 0.00001250 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.974 |
Human Intestinal Absorption (HIA): | 0.624 | 20% Bioavailability (F20%): | 0.696 |
30% Bioavailability (F30%): | 0.647 |
Blood-Brain-Barrier Penetration (BBB): | 0.734 | Plasma Protein Binding (PPB): | 56.45% |
Volume Distribution (VD): | 1.447 | Fu: | 40.03% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.855 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.846 |
CYP2C9-inhibitor: | 0.018 | CYP2C9-substrate: | 0.091 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.283 |
CYP3A4-inhibitor: | 0.023 | CYP3A4-substrate: | 0.265 |
Clearance (CL): | 4.389 | Half-life (T1/2): | 0.56 |
hERG Blockers: | 0.072 | Human Hepatotoxicity (H-HT): | 0.933 |
Drug-inuced Liver Injury (DILI): | 0.943 | AMES Toxicity: | 0.947 |
Rat Oral Acute Toxicity: | 0.537 | Maximum Recommended Daily Dose: | 0.96 |
Skin Sensitization: | 0.382 | Carcinogencity: | 0.368 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.062 |
Respiratory Toxicity: | 0.748 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005493 | ![]() |
0.594 | D07MGA | ![]() |
0.275 | ||
ENC006080 | ![]() |
0.535 | D0Q3VE | ![]() |
0.219 | ||
ENC006081 | ![]() |
0.535 | D0I9HF | ![]() |
0.218 | ||
ENC006047 | ![]() |
0.508 | D0AZ8C | ![]() |
0.214 | ||
ENC006046 | ![]() |
0.464 | D02NSF | ![]() |
0.206 | ||
ENC002669 | ![]() |
0.463 | D0C1SF | ![]() |
0.200 | ||
ENC006043 | ![]() |
0.459 | D03SKD | ![]() |
0.200 | ||
ENC002159 | ![]() |
0.455 | D04UTT | ![]() |
0.198 | ||
ENC002695 | ![]() |
0.455 | D0E9CD | ![]() |
0.197 | ||
ENC002607 | ![]() |
0.455 | D0D4HN | ![]() |
0.197 |