![]() |
Name |
Triticone E
|
Molecular Formula | C14H19NO6 | |
IUPAC Name* |
(3R,4R,5S,6Z,10R)-3,4,10-trihydroxy-2-methoxy-3-methyl-6-propylidene-2-azaspiro[4.5]dec-7-ene-1,9-dione
|
|
SMILES |
CC/C=C\1/C=CC(=O)[C@@H]([C@@]12[C@H]([C@@](N(C2=O)OC)(C)O)O)O
|
|
InChI |
InChI=1S/C14H19NO6/c1-4-5-8-6-7-9(16)10(17)14(8)11(18)13(2,20)15(21-3)12(14)19/h5-7,10-11,17-18,20H,4H2,1-3H3/b8-5-/t10-,11-,13+,14+/m0/s1
|
|
InChIKey |
FFIHXENRVXVAGQ-KZZKGCKGSA-N
|
|
Synonyms |
Triticone E
|
|
CAS | NA | |
PubChem CID | 10266631 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 297.3 | ALogp: | -1.1 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.648 |
Caco-2 Permeability: | -4.915 | MDCK Permeability: | 0.00001490 |
Pgp-inhibitor: | 0.871 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.896 | 20% Bioavailability (F20%): | 0.464 |
30% Bioavailability (F30%): | 0.985 |
Blood-Brain-Barrier Penetration (BBB): | 0.932 | Plasma Protein Binding (PPB): | 13.81% |
Volume Distribution (VD): | 0.652 | Fu: | 78.26% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.578 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.817 |
CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.16 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.077 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.456 |
Clearance (CL): | 3.699 | Half-life (T1/2): | 0.76 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.128 |
Drug-inuced Liver Injury (DILI): | 0.311 | AMES Toxicity: | 0.936 |
Rat Oral Acute Toxicity: | 0.583 | Maximum Recommended Daily Dose: | 0.274 |
Skin Sensitization: | 0.455 | Carcinogencity: | 0.942 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.022 |
Respiratory Toxicity: | 0.731 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004776 | ![]() |
0.719 | D0E9KA | ![]() |
0.223 | ||
ENC004778 | ![]() |
0.376 | D09JBP | ![]() |
0.221 | ||
ENC004777 | ![]() |
0.376 | D08PIQ | ![]() |
0.208 | ||
ENC005216 | ![]() |
0.286 | D0I5DS | ![]() |
0.208 | ||
ENC003242 | ![]() |
0.280 | D0G6AB | ![]() |
0.206 | ||
ENC002743 | ![]() |
0.275 | D07DVK | ![]() |
0.204 | ||
ENC005953 | ![]() |
0.272 | D03IKT | ![]() |
0.204 | ||
ENC001761 | ![]() |
0.272 | D0IT2G | ![]() |
0.204 | ||
ENC000958 | ![]() |
0.261 | D03BLF | ![]() |
0.204 | ||
ENC004679 | ![]() |
0.261 | D0CW1P | ![]() |
0.204 |