![]() |
Name |
(-)-Microdiplodiasolol
|
Molecular Formula | C16H16O7 | |
IUPAC Name* |
(1S,4aS,9aS)-1,8,9a-trihydroxy-4-methoxy-4a,6-dimethyl-1H-xanthene-2,9-dione
|
|
SMILES |
CC1=CC(=C2C(=C1)O[C@@]3(C(=CC(=O)[C@H]([C@]3(C2=O)O)O)OC)C)O
|
|
InChI |
InChI=1S/C16H16O7/c1-7-4-8(17)12-10(5-7)23-15(2)11(22-3)6-9(18)13(19)16(15,21)14(12)20/h4-6,13,17,19,21H,1-3H3/t13-,15-,16-/m1/s1
|
|
InChIKey |
SIUXYUWNLUKHJD-FVQBIDKESA-N
|
|
Synonyms |
Microdiplodiasolol; (-)-microdiplodiasolol; CHEBI:68285; CHEMBL1765411; DTXSID101118354; Q27136779; 1,8,8a-trihydroxy-5-methoxy-3,5a-dimethyl-5a,8a-dihydro-1H-xanthene-7,9-dione; (1S,4aS,9aS)-1,8,9a-trihydroxy-4-methoxy-4a,6-dimethyl-4a,9a-dihydro-1H-xanthene-2,9-dione; 1266115-29-0; 1H-Xanthene-2,9-dione, 4a,9a-dihydro-1,8,9a-trihydroxy-4-methoxy-4a,6-dimethyl-, (1S,4aS,9aS)-
|
|
CAS | 1266115-29-0 | |
PubChem CID | 52937072 | |
ChEMBL ID | CHEMBL1765411 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.29 | ALogp: | 0.4 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.695 |
Caco-2 Permeability: | -4.885 | MDCK Permeability: | 0.00000964 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.025 |
Human Intestinal Absorption (HIA): | 0.121 | 20% Bioavailability (F20%): | 0.078 |
30% Bioavailability (F30%): | 0.307 |
Blood-Brain-Barrier Penetration (BBB): | 0.642 | Plasma Protein Binding (PPB): | 76.57% |
Volume Distribution (VD): | 0.701 | Fu: | 19.96% |
CYP1A2-inhibitor: | 0.094 | CYP1A2-substrate: | 0.625 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.812 |
CYP2C9-inhibitor: | 0.04 | CYP2C9-substrate: | 0.057 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.135 |
CYP3A4-inhibitor: | 0.13 | CYP3A4-substrate: | 0.624 |
Clearance (CL): | 4.418 | Half-life (T1/2): | 0.258 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.156 |
Drug-inuced Liver Injury (DILI): | 0.94 | AMES Toxicity: | 0.156 |
Rat Oral Acute Toxicity: | 0.068 | Maximum Recommended Daily Dose: | 0.105 |
Skin Sensitization: | 0.41 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.039 |
Respiratory Toxicity: | 0.95 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002175 | ![]() |
0.500 | D0C1SF | ![]() |
0.299 | ||
ENC004117 | ![]() |
0.440 | D07MGA | ![]() |
0.298 | ||
ENC002171 | ![]() |
0.422 | D0J2NK | ![]() |
0.256 | ||
ENC003213 | ![]() |
0.418 | D08NQZ | ![]() |
0.250 | ||
ENC004116 | ![]() |
0.409 | D0S0LZ | ![]() |
0.239 | ||
ENC003538 | ![]() |
0.407 | D06GCK | ![]() |
0.238 | ||
ENC004059 | ![]() |
0.404 | D0R6RC | ![]() |
0.235 | ||
ENC005981 | ![]() |
0.387 | D0H1AR | ![]() |
0.229 | ||
ENC002741 | ![]() |
0.379 | D0G4KG | ![]() |
0.226 | ||
ENC002311 | ![]() |
0.372 | D0P1FO | ![]() |
0.225 |