![]() |
Name |
3,7,11,15-Tetramethylhexadec-2-EN-1-YL acetate
|
Molecular Formula | C22H42O2 | |
IUPAC Name* |
[(E)-3,7,11,15-tetramethylhexadec-2-enyl] acetate
|
|
SMILES |
CC(C)CCCC(C)CCCC(C)CCC/C(=C/COC(=O)C)/C
|
|
InChI |
InChI=1S/C22H42O2/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-24-22(6)23/h16,18-20H,7-15,17H2,1-6H3/b21-16+
|
|
InChIKey |
JIGCTXHIECXYRJ-LTGZKZEYSA-N
|
|
Synonyms |
Phytyl acetate; Phytol acetate; Acetic Acid 3,7,11,15-Tetramethyl-2-hexadecenyl Ester; 3,7,11,15-TETRAMETHYLHEXADEC-2-EN-1-YL ACETATE; Phytol, acetate; SCHEMBL215081; (R-(R*,R*-(E)))-3,7,11,15-Tetramethylhexadec-2-enyl acetate; [(E)-3,7,11,15-tetramethylhexadec-2-enyl] acetate; CHEMBL593049; CHEBI:180024; CS-0339787; P1675; J-000678; Q67880053; (2E)-3,7,11,15-tetramethylhexadec-2-en-1-yl acetate; 3,7,11,15-Tetramethyl-acetate(2E)-2-hexadecen-1-ol; Acetic acid 3,7,11,15-tetramethyl-hexadec-2-enyl ester; 3,7,11,15-Tetramethyl-2-hexadecenyl Acetate (cis- and trans- mixture); Acetic Acid 3,7,11,15-Tetramethyl-2-hexadecenyl Ester (cis- and trans- mixture)
|
|
CAS | 10236-16-5 | |
PubChem CID | 6428538 | |
ChEMBL ID | CHEMBL593049 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.6 | ALogp: | 8.8 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 24 | QED Weighted: | 0.255 |
Caco-2 Permeability: | -4.574 | MDCK Permeability: | 0.00001280 |
Pgp-inhibitor: | 0.651 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.967 |
30% Bioavailability (F30%): | 0.956 |
Blood-Brain-Barrier Penetration (BBB): | 0.638 | Plasma Protein Binding (PPB): | 99.20% |
Volume Distribution (VD): | 1.641 | Fu: | 2.71% |
CYP1A2-inhibitor: | 0.305 | CYP1A2-substrate: | 0.176 |
CYP2C19-inhibitor: | 0.355 | CYP2C19-substrate: | 0.188 |
CYP2C9-inhibitor: | 0.403 | CYP2C9-substrate: | 0.896 |
CYP2D6-inhibitor: | 0.171 | CYP2D6-substrate: | 0.038 |
CYP3A4-inhibitor: | 0.298 | CYP3A4-substrate: | 0.164 |
Clearance (CL): | 4.319 | Half-life (T1/2): | 0.114 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.034 |
Drug-inuced Liver Injury (DILI): | 0.261 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.029 |
Skin Sensitization: | 0.964 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.808 | Eye Irritation: | 0.862 |
Respiratory Toxicity: | 0.164 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001412 | ![]() |
1.000 | D00FSV | ![]() |
0.515 | ||
ENC001722 | ![]() |
0.743 | D0ZI4H | ![]() |
0.241 | ||
ENC001286 | ![]() |
0.611 | D0X4FM | ![]() |
0.239 | ||
ENC000766 | ![]() |
0.609 | D09XWD | ![]() |
0.238 | ||
ENC000354 | ![]() |
0.608 | D0D9NY | ![]() |
0.231 | ||
ENC000538 | ![]() |
0.606 | D03LGY | ![]() |
0.229 | ||
ENC000441 | ![]() |
0.587 | D03JSJ | ![]() |
0.229 | ||
ENC000537 | ![]() |
0.565 | D0G2KD | ![]() |
0.221 | ||
ENC000627 | ![]() |
0.564 | D0T9TJ | ![]() |
0.216 | ||
ENC001798 | ![]() |
0.548 | D0AY9Q | ![]() |
0.216 |