|
Name |
Campesterol
|
| Molecular Formula | C28H48O | |
| IUPAC Name* |
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
|
|
| SMILES |
C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
|
|
| InChI |
InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1
|
|
| InChIKey |
SGNBVLSWZMBQTH-PODYLUTMSA-N
|
|
| Synonyms |
CAMPESTEROL; 474-62-4; Campesterin; Campasterol; Campest-5-en-3beta-ol; 24(R)-methylcholesterol; Ergost-5-en-3-ol, (3beta,24R)-; Ergost-5-en-3-ol, (3b,24R)-; NSC 224330; (24R)-5-Ergosten-3b-ol; CHEBI:28623; Ergost-5-en-3beta-ol, (24R)-; (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol; .DELTA.5-24-Isoergosten-3.beta.-ol; 5L5O665639; 24.alpha.-Methylcholesterol; Ergost-5-en-3-ol; (24S)-beta-Methyl cholesterol; Mieyajunsu A; NSC-224330; (24R)-Methylcholest-5-en-3.beta.-ol; (3beta,24R)-ergost-5-en-3-ol; (8R,9S,10S,13R,14S,17R)-17-((2R,5R)-5,6-Dimethylheptan-2-yl)-10,13-dimethyl-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol; 24.alpha.-Methyl-5-cholesten-3.beta.-ol; Ergost-5-en-3-ol-, (24R, 3.beta.)-; 24a-Methylcholesterol; Campest-5-en-3-ol; CAMPESTEROL [MI]; 24alpha-Methylcholesterol; 24|A-methyl Cholesterol; Ergost-5-en-3-beta-ol; 24-alpha-Methylcholesterol; SCHEMBL94161; CAMPESTEROL [WHO-DD]; (24R)ergost-5-en-3beta-ol; 24-methyl-5-Cholestene-3-ol; CHEMBL520535; (24R)-Ergost-5-en-3b-ol; (3-beta)-Ergost-5-en-3-ol; 24a-Methyl-5-cholesten-3b-ol; delta5-24-Isoergosten-3beta-ol; (24R)-5-Ergosten-3-beta-ol; (24R)-Ergost-5-en-3beta-ol; cholest 5-en-3-ol, 24-methyl; 24-Methylcholest-5-en-3beta-ol; (24R)-Ergost-5-en-3-beta-ol; DTXSID801009891; UNII-5L5O665639; (3b,24R)-Ergost-5-en-3-ol; (24R)-Methylcholest-5-en-3b-ol; HY-N1459; ZINC4095721; EINECS 207-484-4; LMST01030097; MFCD28143670; (3-beta-24R)-Ergost-5-en-3-ol; CS-6302; (24R)-24-methylcholest-5-en-3beta-ol; AC-34100; (3.BETA.,24R)-ERGOST-5-EN-3-OL; C01789; CAMPESTEROL (CONSTITUENT OF PYGEUM) [DSC]; Q2756479; CAMPESTEROL (CONSTITUENT OF SAW PALMETTO) [DSC]; BF0849B6-7A25-4057-93A9-EB053E920C49
|
|
| CAS | 474-62-4 | |
| PubChem CID | 173183 | |
| ChEMBL ID | CHEMBL520535 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 400.7 | ALogp: | 8.8 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.461 |
| Caco-2 Permeability: | -4.65 | MDCK Permeability: | 0.00001100 |
| Pgp-inhibitor: | 0.967 | Pgp-substrate: | 0.102 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.942 |
| 30% Bioavailability (F30%): | 0.059 |
| Blood-Brain-Barrier Penetration (BBB): | 0.239 | Plasma Protein Binding (PPB): | 93.93% |
| Volume Distribution (VD): | 1.511 | Fu: | 1.33% |
| CYP1A2-inhibitor: | 0.112 | CYP1A2-substrate: | 0.555 |
| CYP2C19-inhibitor: | 0.135 | CYP2C19-substrate: | 0.937 |
| CYP2C9-inhibitor: | 0.182 | CYP2C9-substrate: | 0.128 |
| CYP2D6-inhibitor: | 0.097 | CYP2D6-substrate: | 0.442 |
| CYP3A4-inhibitor: | 0.445 | CYP3A4-substrate: | 0.744 |
| Clearance (CL): | 7.684 | Half-life (T1/2): | 0.052 |
| hERG Blockers: | 0.765 | Human Hepatotoxicity (H-HT): | 0.128 |
| Drug-inuced Liver Injury (DILI): | 0.632 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.167 |
| Skin Sensitization: | 0.965 | Carcinogencity: | 0.148 |
| Eye Corrosion: | 0.939 | Eye Irritation: | 0.888 |
| Respiratory Toxicity: | 0.508 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001008 | ![]() |
0.852 | D0Y7LD | ![]() |
0.852 | ||
| ENC001107 | ![]() |
0.852 | D0B4RU | ![]() |
0.600 | ||
| ENC000125 | ![]() |
0.816 | D0K0EK | ![]() |
0.511 | ||
| ENC001558 | ![]() |
0.739 | D03ZTE | ![]() |
0.427 | ||
| ENC004758 | ![]() |
0.739 | D0G3SH | ![]() |
0.427 | ||
| ENC001545 | ![]() |
0.716 | D02STN | ![]() |
0.409 | ||
| ENC001647 | ![]() |
0.676 | D0M4WA | ![]() |
0.409 | ||
| ENC001475 | ![]() |
0.660 | D06XMU | ![]() |
0.404 | ||
| ENC005068 | ![]() |
0.632 | D07BSQ | ![]() |
0.371 | ||
| ENC001170 | ![]() |
0.594 | D04DJN | ![]() |
0.363 | ||